About 3-cyclohexa-1,3-dien-1-yl-1-oxa-8-azaspiro[4.5]dec-3-ene
3-cyclohexa-1,3-dien-1-yl-1-oxa-8-azaspiro[4.5]dec-3-ene (PubChem CID 173075838) has the molecular formula C14H19NO
and a molecular weight of 217.31 g/mol. Its IUPAC name is 3-cyclohexa-1,3-dien-1-yl-1-oxa-8-azaspiro[4.5]dec-3-ene.
Molecular Properties
| Compound Name | 3-cyclohexa-1,3-dien-1-yl-1-oxa-8-azaspiro[4.5]dec-3-ene |
| PubChem CID | 173075838 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | 3-cyclohexa-1,3-dien-1-yl-1-oxa-8-azaspiro[4.5]dec-3-ene |
| SMILES | C1=CCCC(C2=CC3(CCNCC3)OC2)=C1 |
| InChI | InChI=1S/C14H19NO/c1-2-4-12(5-3-1)13-10-14(16-11-13)6-8-15-9-7-14/h1-2,4,10,15H,3,5-9,11H2 |
| InChIKey | KFGSZNXHTFSBFI-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-cyclohexa-1,3-dien-1-yl-1-oxa-8-azaspiro[4.5]dec-3-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclohexa-1,3-dien-1-yl-1-oxa-8-azaspiro[4.5]dec-3-ene?
The IUPAC name of 3-cyclohexa-1,3-dien-1-yl-1-oxa-8-azaspiro[4.5]dec-3-ene (CID 173075838) is 3-cyclohexa-1,3-dien-1-yl-1-oxa-8-azaspiro[4.5]dec-3-ene.
What is the SMILES notation for 3-cyclohexa-1,3-dien-1-yl-1-oxa-8-azaspiro[4.5]dec-3-ene?
The canonical SMILES for 3-cyclohexa-1,3-dien-1-yl-1-oxa-8-azaspiro[4.5]dec-3-ene is C1=CCCC(C2=CC3(CCNCC3)OC2)=C1.
What is the InChIKey of 3-cyclohexa-1,3-dien-1-yl-1-oxa-8-azaspiro[4.5]dec-3-ene?
The InChIKey is KFGSZNXHTFSBFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO/c1-2-4-12(5-3-1)13-10-14(16-11-13)6-8-15-9-7-14/h1-2,4,10,15H,3,5-9,11H2.
What are the key properties of 3-cyclohexa-1,3-dien-1-yl-1-oxa-8-azaspiro[4.5]dec-3-ene?
3-cyclohexa-1,3-dien-1-yl-1-oxa-8-azaspiro[4.5]dec-3-ene has a molecular weight of 217.31 g/mol, XLogP of 2.34, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclohexa-1,3-dien-1-yl-1-oxa-8-azaspiro[4.5]dec-3-ene is sourced from PubChem (CID 173075838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).