C8H14ClNO5S — CID 173075937
[[chloro-(2,2,4-trimethyl-1,3-dioxolan-4-yl)methylidene]amino] methanesulfonate (PubChem CID 173075937) has the molecular formula C8H14ClNO5S and a molecular weight of 271.72 g/mol. Its IUPAC name is [[chloro-(2,2,4-trimethyl-1,3-dioxolan-4-yl)methylidene]amino] methanesulfonate.
| Compound Name | [[chloro-(2,2,4-trimethyl-1,3-dioxolan-4-yl)methylidene]amino] methanesulfonate |
|---|---|
| PubChem CID | 173075937 |
| Molecular Formula | C8H14ClNO5S |
| Molecular Weight | 271.72 g/mol |
| Exact Mass | 271.03 |
| IUPAC Name | [[chloro-(2,2,4-trimethyl-1,3-dioxolan-4-yl)methylidene]amino] methanesulfonate |
| SMILES | CC1(C)OCC(C)(C(Cl)=NOS(C)(=O)=O)O1 |
| InChI | InChI=1S/C8H14ClNO5S/c1-7(2)13-5-8(3,14-7)6(9)10-15-16(4,11)12/h5H2,1-4H3 |
| InChIKey | JDDAEPODAHHOBM-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.72 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|