C10H16O2Rh — CID 173076417
acetic acid;cycloocta-1,3-diene;rhodium (PubChem CID 173076417) has the molecular formula C10H16O2Rh and a molecular weight of 271.14 g/mol. Its IUPAC name is acetic acid;cycloocta-1,3-diene;rhodium.
| Compound Name | acetic acid;cycloocta-1,3-diene;rhodium |
|---|---|
| PubChem CID | 173076417 |
| Molecular Formula | C10H16O2Rh |
| Molecular Weight | 271.14 g/mol |
| Exact Mass | 271.02 |
| IUPAC Name | acetic acid;cycloocta-1,3-diene;rhodium |
| SMILES | C1=CCCCCC=C1.CC(=O)O.[Rh] |
| InChI | InChI=1S/C8H12.C2H4O2.Rh/c1-2-4-6-8-7-5-3-1;1-2(3)4;/h1-4H,5-8H2;1H3,(H,3,4); |
| InChIKey | SWDHBIJJTPUKJC-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.14 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |