About ethenyl cyclopropanecarboxylate;ethenylsilane
ethenyl cyclopropanecarboxylate;ethenylsilane (PubChem CID 173077212) has the molecular formula C8H14O2Si
and a molecular weight of 170.28 g/mol. Its IUPAC name is ethenyl cyclopropanecarboxylate;ethenylsilane.
Molecular Properties
| Compound Name | ethenyl cyclopropanecarboxylate;ethenylsilane |
| PubChem CID | 173077212 |
| Molecular Formula | C8H14O2Si |
| Molecular Weight | 170.28 g/mol |
| Exact Mass | 170.08 |
| IUPAC Name | ethenyl cyclopropanecarboxylate;ethenylsilane |
| SMILES | C=COC(=O)C1CC1.C=C[SiH3] |
| InChI | InChI=1S/C6H8O2.C2H6Si/c1-2-8-6(7)5-3-4-5;1-2-3/h2,5H,1,3-4H2;2H,1H2,3H3 |
| InChIKey | HOZNFVYVBRQVPI-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.28 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze ethenyl cyclopropanecarboxylate;ethenylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenyl cyclopropanecarboxylate;ethenylsilane?
The IUPAC name of ethenyl cyclopropanecarboxylate;ethenylsilane (CID 173077212) is ethenyl cyclopropanecarboxylate;ethenylsilane.
What is the SMILES notation for ethenyl cyclopropanecarboxylate;ethenylsilane?
The canonical SMILES for ethenyl cyclopropanecarboxylate;ethenylsilane is C=COC(=O)C1CC1.C=C[SiH3].
What is the InChIKey of ethenyl cyclopropanecarboxylate;ethenylsilane?
The InChIKey is HOZNFVYVBRQVPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8O2.C2H6Si/c1-2-8-6(7)5-3-4-5;1-2-3/h2,5H,1,3-4H2;2H,1H2,3H3.
What are the key properties of ethenyl cyclopropanecarboxylate;ethenylsilane?
ethenyl cyclopropanecarboxylate;ethenylsilane has a molecular weight of 170.28 g/mol, XLogP of 0.58, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethenyl cyclopropanecarboxylate;ethenylsilane is sourced from PubChem (CID 173077212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).