About biphenylene;hydron
biphenylene;hydron (PubChem CID 173077542) has the molecular formula C12H9+
and a molecular weight of 153.20 g/mol. Its IUPAC name is biphenylene;hydron.
Molecular Properties
| Compound Name | biphenylene;hydron |
| PubChem CID | 173077542 |
| Molecular Formula | C12H9+ |
| Molecular Weight | 153.20 g/mol |
| Exact Mass | 153.07 |
| IUPAC Name | biphenylene;hydron |
| SMILES | [H+].c1ccc2c(c1)-c1ccccc1-2 |
| InChI | InChI=1S/C12H8/c1-2-6-10-9(5-1)11-7-3-4-8-12(10)11/h1-8H/p+1 |
| InChIKey | IFVTZJHWGZSXFD-UHFFFAOYSA-O |
| XLogP | 3.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.20 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze biphenylene;hydron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of biphenylene;hydron?
The IUPAC name of biphenylene;hydron (CID 173077542) is biphenylene;hydron.
What is the SMILES notation for biphenylene;hydron?
The canonical SMILES for biphenylene;hydron is [H+].c1ccc2c(c1)-c1ccccc1-2.
What is the InChIKey of biphenylene;hydron?
The InChIKey is IFVTZJHWGZSXFD-UHFFFAOYSA-O. The full InChI is InChI=1S/C12H8/c1-2-6-10-9(5-1)11-7-3-4-8-12(10)11/h1-8H/p+1.
What are the key properties of biphenylene;hydron?
biphenylene;hydron has a molecular weight of 153.20 g/mol, XLogP of 3.45, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for biphenylene;hydron is sourced from PubChem (CID 173077542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).