About 2-[3,4-bis(trifluoromethyl)phenoxy]-1,3-thiazole
2-[3,4-bis(trifluoromethyl)phenoxy]-1,3-thiazole (PubChem CID 173078203) has the molecular formula C11H5F6NOS
and a molecular weight of 313.22 g/mol. Its IUPAC name is 2-[3,4-bis(trifluoromethyl)phenoxy]-1,3-thiazole.
Molecular Properties
| Compound Name | 2-[3,4-bis(trifluoromethyl)phenoxy]-1,3-thiazole |
| PubChem CID | 173078203 |
| Molecular Formula | C11H5F6NOS |
| Molecular Weight | 313.22 g/mol |
| Exact Mass | 313.00 |
| IUPAC Name | 2-[3,4-bis(trifluoromethyl)phenoxy]-1,3-thiazole |
| SMILES | FC(F)(F)c1ccc(Oc2nccs2)cc1C(F)(F)F |
| InChI | InChI=1S/C11H5F6NOS/c12-10(13,14)7-2-1-6(5-8(7)11(15,16)17)19-9-18-3-4-20-9/h1-5H |
| InChIKey | KHVKUTQJJSCJLT-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.22 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[3,4-bis(trifluoromethyl)phenoxy]-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3,4-bis(trifluoromethyl)phenoxy]-1,3-thiazole?
The IUPAC name of 2-[3,4-bis(trifluoromethyl)phenoxy]-1,3-thiazole (CID 173078203) is 2-[3,4-bis(trifluoromethyl)phenoxy]-1,3-thiazole.
What is the SMILES notation for 2-[3,4-bis(trifluoromethyl)phenoxy]-1,3-thiazole?
The canonical SMILES for 2-[3,4-bis(trifluoromethyl)phenoxy]-1,3-thiazole is FC(F)(F)c1ccc(Oc2nccs2)cc1C(F)(F)F.
What is the InChIKey of 2-[3,4-bis(trifluoromethyl)phenoxy]-1,3-thiazole?
The InChIKey is KHVKUTQJJSCJLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H5F6NOS/c12-10(13,14)7-2-1-6(5-8(7)11(15,16)17)19-9-18-3-4-20-9/h1-5H.
What are the key properties of 2-[3,4-bis(trifluoromethyl)phenoxy]-1,3-thiazole?
2-[3,4-bis(trifluoromethyl)phenoxy]-1,3-thiazole has a molecular weight of 313.22 g/mol, XLogP of 4.97, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3,4-bis(trifluoromethyl)phenoxy]-1,3-thiazole is sourced from PubChem (CID 173078203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).