About N,N-diethyl-2-(3-methyl-2H-imidazol-1-yl)acetamide;hydrobromide
N,N-diethyl-2-(3-methyl-2H-imidazol-1-yl)acetamide;hydrobromide (PubChem CID 173078377) has the molecular formula C10H20BrN3O
and a molecular weight of 278.19 g/mol. Its IUPAC name is N,N-diethyl-2-(3-methyl-2H-imidazol-1-yl)acetamide;hydrobromide.
Molecular Properties
| Compound Name | N,N-diethyl-2-(3-methyl-2H-imidazol-1-yl)acetamide;hydrobromide |
| PubChem CID | 173078377 |
| Molecular Formula | C10H20BrN3O |
| Molecular Weight | 278.19 g/mol |
| Exact Mass | 277.08 |
| IUPAC Name | N,N-diethyl-2-(3-methyl-2H-imidazol-1-yl)acetamide;hydrobromide |
| SMILES | Br.CCN(CC)C(=O)CN1C=CN(C)C1 |
| InChI | InChI=1S/C10H19N3O.BrH/c1-4-13(5-2)10(14)8-12-7-6-11(3)9-12;/h6-7H,4-5,8-9H2,1-3H3;1H |
| InChIKey | TWIUCFXIQFUOEP-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.19 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N,N-diethyl-2-(3-methyl-2H-imidazol-1-yl)acetamide;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethyl-2-(3-methyl-2H-imidazol-1-yl)acetamide;hydrobromide?
The IUPAC name of N,N-diethyl-2-(3-methyl-2H-imidazol-1-yl)acetamide;hydrobromide (CID 173078377) is N,N-diethyl-2-(3-methyl-2H-imidazol-1-yl)acetamide;hydrobromide.
What is the SMILES notation for N,N-diethyl-2-(3-methyl-2H-imidazol-1-yl)acetamide;hydrobromide?
The canonical SMILES for N,N-diethyl-2-(3-methyl-2H-imidazol-1-yl)acetamide;hydrobromide is Br.CCN(CC)C(=O)CN1C=CN(C)C1.
What is the InChIKey of N,N-diethyl-2-(3-methyl-2H-imidazol-1-yl)acetamide;hydrobromide?
The InChIKey is TWIUCFXIQFUOEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N3O.BrH/c1-4-13(5-2)10(14)8-12-7-6-11(3)9-12;/h6-7H,4-5,8-9H2,1-3H3;1H.
What are the key properties of N,N-diethyl-2-(3-methyl-2H-imidazol-1-yl)acetamide;hydrobromide?
N,N-diethyl-2-(3-methyl-2H-imidazol-1-yl)acetamide;hydrobromide has a molecular weight of 278.19 g/mol, XLogP of 1.11, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethyl-2-(3-methyl-2H-imidazol-1-yl)acetamide;hydrobromide is sourced from PubChem (CID 173078377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).