C14H27N3O3 — CID 173078415
1-[(2S)-2-(3,4-dihydroxypiperidin-1-yl)propyl]piperidine-2-carboxamide (PubChem CID 173078415) has the molecular formula C14H27N3O3 and a molecular weight of 285.39 g/mol. Its IUPAC name is 1-[(2S)-2-(3,4-dihydroxypiperidin-1-yl)propyl]piperidine-2-carboxamide.
| Compound Name | 1-[(2S)-2-(3,4-dihydroxypiperidin-1-yl)propyl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 173078415 |
| Molecular Formula | C14H27N3O3 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.21 |
| IUPAC Name | 1-[(2S)-2-(3,4-dihydroxypiperidin-1-yl)propyl]piperidine-2-carboxamide |
| SMILES | C[C@@H](CN1CCCCC1C(N)=O)N1CCC(O)C(O)C1 |
| InChI | InChI=1S/C14H27N3O3/c1-10(16-7-5-12(18)13(19)9-16)8-17-6-3-2-4-11(17)14(15)20/h10-13,18-19H,2-9H2,1H3,(H2,15,20)/t10-,11?,12?,13?/m0/s1 |
| InChIKey | MFNQFZVFVZLHPU-DCNVRKPOSA-N |
| XLogP | -0.86 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |