About 5,8a-dihydro-4aH-pyridazino[3,4-b][1,4]thiazin-6-one
5,8a-dihydro-4aH-pyridazino[3,4-b][1,4]thiazin-6-one (PubChem CID 173078648) has the molecular formula C6H7N3OS
and a molecular weight of 169.21 g/mol. Its IUPAC name is 5,8a-dihydro-4aH-pyridazino[3,4-b][1,4]thiazin-6-one.
Analyze 5,8a-dihydro-4aH-pyridazino[3,4-b][1,4]thiazin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,8a-dihydro-4aH-pyridazino[3,4-b][1,4]thiazin-6-one?
The IUPAC name of 5,8a-dihydro-4aH-pyridazino[3,4-b][1,4]thiazin-6-one (CID 173078648) is 5,8a-dihydro-4aH-pyridazino[3,4-b][1,4]thiazin-6-one.
What is the SMILES notation for 5,8a-dihydro-4aH-pyridazino[3,4-b][1,4]thiazin-6-one?
The canonical SMILES for 5,8a-dihydro-4aH-pyridazino[3,4-b][1,4]thiazin-6-one is O=C1CSC2N=NC=CC2N1.
What is the InChIKey of 5,8a-dihydro-4aH-pyridazino[3,4-b][1,4]thiazin-6-one?
The InChIKey is OJJNMUNZOLLRJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N3OS/c10-5-3-11-6-4(8-5)1-2-7-9-6/h1-2,4,6H,3H2,(H,8,10).
What are the key properties of 5,8a-dihydro-4aH-pyridazino[3,4-b][1,4]thiazin-6-one?
5,8a-dihydro-4aH-pyridazino[3,4-b][1,4]thiazin-6-one has a molecular weight of 169.21 g/mol, XLogP of 0.52, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,8a-dihydro-4aH-pyridazino[3,4-b][1,4]thiazin-6-one is sourced from PubChem (CID 173078648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).