About 5,6-dihydro-[1]benzoxepino[4,5-d]pyridazin-3-ium
5,6-dihydro-[1]benzoxepino[4,5-d]pyridazin-3-ium (PubChem CID 173079412) has the molecular formula C12H11N2O+
and a molecular weight of 199.23 g/mol. Its IUPAC name is 5,6-dihydro-[1]benzoxepino[4,5-d]pyridazin-3-ium.
Molecular Properties
| Compound Name | 5,6-dihydro-[1]benzoxepino[4,5-d]pyridazin-3-ium |
| PubChem CID | 173079412 |
| Molecular Formula | C12H11N2O+ |
| Molecular Weight | 199.23 g/mol |
| Exact Mass | 199.09 |
| IUPAC Name | 5,6-dihydro-[1]benzoxepino[4,5-d]pyridazin-3-ium |
| SMILES | c1ccc2c(c1)OCCc1c[nH+]ncc1-2 |
| InChI | InChI=1S/C12H10N2O/c1-2-4-12-10(3-1)11-8-14-13-7-9(11)5-6-15-12/h1-4,7-8H,5-6H2/p+1 |
| InChIKey | NTMOZLHJHFYNOB-UHFFFAOYSA-O |
| XLogP | 1.50 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.23 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5,6-dihydro-[1]benzoxepino[4,5-d]pyridazin-3-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dihydro-[1]benzoxepino[4,5-d]pyridazin-3-ium?
The IUPAC name of 5,6-dihydro-[1]benzoxepino[4,5-d]pyridazin-3-ium (CID 173079412) is 5,6-dihydro-[1]benzoxepino[4,5-d]pyridazin-3-ium.
What is the SMILES notation for 5,6-dihydro-[1]benzoxepino[4,5-d]pyridazin-3-ium?
The canonical SMILES for 5,6-dihydro-[1]benzoxepino[4,5-d]pyridazin-3-ium is c1ccc2c(c1)OCCc1c[nH+]ncc1-2.
What is the InChIKey of 5,6-dihydro-[1]benzoxepino[4,5-d]pyridazin-3-ium?
The InChIKey is NTMOZLHJHFYNOB-UHFFFAOYSA-O. The full InChI is InChI=1S/C12H10N2O/c1-2-4-12-10(3-1)11-8-14-13-7-9(11)5-6-15-12/h1-4,7-8H,5-6H2/p+1.
What are the key properties of 5,6-dihydro-[1]benzoxepino[4,5-d]pyridazin-3-ium?
5,6-dihydro-[1]benzoxepino[4,5-d]pyridazin-3-ium has a molecular weight of 199.23 g/mol, XLogP of 1.50, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dihydro-[1]benzoxepino[4,5-d]pyridazin-3-ium is sourced from PubChem (CID 173079412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).