About methyl 2-(2-bromoacetyl)pyridine-3-carboxylate;hydrobromide
methyl 2-(2-bromoacetyl)pyridine-3-carboxylate;hydrobromide (PubChem CID 173079683) has the molecular formula C9H9Br2NO3
and a molecular weight of 338.98 g/mol. Its IUPAC name is methyl 2-(2-bromoacetyl)pyridine-3-carboxylate;hydrobromide.
Molecular Properties
| Compound Name | methyl 2-(2-bromoacetyl)pyridine-3-carboxylate;hydrobromide |
| PubChem CID | 173079683 |
| Molecular Formula | C9H9Br2NO3 |
| Molecular Weight | 338.98 g/mol |
| Exact Mass | 336.89 |
| IUPAC Name | methyl 2-(2-bromoacetyl)pyridine-3-carboxylate;hydrobromide |
| SMILES | Br.COC(=O)c1cccnc1C(=O)CBr |
| InChI | InChI=1S/C9H8BrNO3.BrH/c1-14-9(13)6-3-2-4-11-8(6)7(12)5-10;/h2-4H,5H2,1H3;1H |
| InChIKey | KWBAVEIXPYTKFF-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.98 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-(2-bromoacetyl)pyridine-3-carboxylate;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(2-bromoacetyl)pyridine-3-carboxylate;hydrobromide?
The IUPAC name of methyl 2-(2-bromoacetyl)pyridine-3-carboxylate;hydrobromide (CID 173079683) is methyl 2-(2-bromoacetyl)pyridine-3-carboxylate;hydrobromide.
What is the SMILES notation for methyl 2-(2-bromoacetyl)pyridine-3-carboxylate;hydrobromide?
The canonical SMILES for methyl 2-(2-bromoacetyl)pyridine-3-carboxylate;hydrobromide is Br.COC(=O)c1cccnc1C(=O)CBr.
What is the InChIKey of methyl 2-(2-bromoacetyl)pyridine-3-carboxylate;hydrobromide?
The InChIKey is KWBAVEIXPYTKFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8BrNO3.BrH/c1-14-9(13)6-3-2-4-11-8(6)7(12)5-10;/h2-4H,5H2,1H3;1H.
What are the key properties of methyl 2-(2-bromoacetyl)pyridine-3-carboxylate;hydrobromide?
methyl 2-(2-bromoacetyl)pyridine-3-carboxylate;hydrobromide has a molecular weight of 338.98 g/mol, XLogP of 2.02, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(2-bromoacetyl)pyridine-3-carboxylate;hydrobromide is sourced from PubChem (CID 173079683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).