About (3-butyl-4-cyclopenta-1,3-dien-1-ylcyclopenta-2,4-dien-1-ylidene)-dimethylsilane
(3-butyl-4-cyclopenta-1,3-dien-1-ylcyclopenta-2,4-dien-1-ylidene)-dimethylsilane (PubChem CID 173079928) has the molecular formula C16H22Si
and a molecular weight of 242.44 g/mol. Its IUPAC name is (3-butyl-4-cyclopenta-1,3-dien-1-ylcyclopenta-2,4-dien-1-ylidene)-dimethylsilane.
Molecular Properties
| Compound Name | (3-butyl-4-cyclopenta-1,3-dien-1-ylcyclopenta-2,4-dien-1-ylidene)-dimethylsilane |
| PubChem CID | 173079928 |
| Molecular Formula | C16H22Si |
| Molecular Weight | 242.44 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | (3-butyl-4-cyclopenta-1,3-dien-1-ylcyclopenta-2,4-dien-1-ylidene)-dimethylsilane |
| SMILES | CCCCC1=CC(=[Si](C)C)C=C1C1=CC=CC1 |
| InChI | InChI=1S/C16H22Si/c1-4-5-8-14-11-15(17(2)3)12-16(14)13-9-6-7-10-13/h6-7,9,11-12H,4-5,8,10H2,1-3H3 |
| InChIKey | HMGQZDAPMHMVFV-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.44 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (3-butyl-4-cyclopenta-1,3-dien-1-ylcyclopenta-2,4-dien-1-ylidene)-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-butyl-4-cyclopenta-1,3-dien-1-ylcyclopenta-2,4-dien-1-ylidene)-dimethylsilane?
The IUPAC name of (3-butyl-4-cyclopenta-1,3-dien-1-ylcyclopenta-2,4-dien-1-ylidene)-dimethylsilane (CID 173079928) is (3-butyl-4-cyclopenta-1,3-dien-1-ylcyclopenta-2,4-dien-1-ylidene)-dimethylsilane.
What is the SMILES notation for (3-butyl-4-cyclopenta-1,3-dien-1-ylcyclopenta-2,4-dien-1-ylidene)-dimethylsilane?
The canonical SMILES for (3-butyl-4-cyclopenta-1,3-dien-1-ylcyclopenta-2,4-dien-1-ylidene)-dimethylsilane is CCCCC1=CC(=[Si](C)C)C=C1C1=CC=CC1.
What is the InChIKey of (3-butyl-4-cyclopenta-1,3-dien-1-ylcyclopenta-2,4-dien-1-ylidene)-dimethylsilane?
The InChIKey is HMGQZDAPMHMVFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22Si/c1-4-5-8-14-11-15(17(2)3)12-16(14)13-9-6-7-10-13/h6-7,9,11-12H,4-5,8,10H2,1-3H3.
What are the key properties of (3-butyl-4-cyclopenta-1,3-dien-1-ylcyclopenta-2,4-dien-1-ylidene)-dimethylsilane?
(3-butyl-4-cyclopenta-1,3-dien-1-ylcyclopenta-2,4-dien-1-ylidene)-dimethylsilane has a molecular weight of 242.44 g/mol, XLogP of 4.44, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (3-butyl-4-cyclopenta-1,3-dien-1-ylcyclopenta-2,4-dien-1-ylidene)-dimethylsilane is sourced from PubChem (CID 173079928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).