About 3-but-2-enyl-2,4,6-trifluorobenzoic acid
3-but-2-enyl-2,4,6-trifluorobenzoic acid (PubChem CID 173080788) has the molecular formula C11H9F3O2
and a molecular weight of 230.18 g/mol. Its IUPAC name is 3-but-2-enyl-2,4,6-trifluorobenzoic acid.
Molecular Properties
| Compound Name | 3-but-2-enyl-2,4,6-trifluorobenzoic acid |
| PubChem CID | 173080788 |
| Molecular Formula | C11H9F3O2 |
| Molecular Weight | 230.18 g/mol |
| Exact Mass | 230.06 |
| IUPAC Name | 3-but-2-enyl-2,4,6-trifluorobenzoic acid |
| SMILES | CC=CCc1c(F)cc(F)c(C(=O)O)c1F |
| InChI | InChI=1S/C11H9F3O2/c1-2-3-4-6-7(12)5-8(13)9(10(6)14)11(15)16/h2-3,5H,4H2,1H3,(H,15,16) |
| InChIKey | IAVUSPSLQXBXKK-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.18 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-but-2-enyl-2,4,6-trifluorobenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-but-2-enyl-2,4,6-trifluorobenzoic acid?
The IUPAC name of 3-but-2-enyl-2,4,6-trifluorobenzoic acid (CID 173080788) is 3-but-2-enyl-2,4,6-trifluorobenzoic acid.
What is the SMILES notation for 3-but-2-enyl-2,4,6-trifluorobenzoic acid?
The canonical SMILES for 3-but-2-enyl-2,4,6-trifluorobenzoic acid is CC=CCc1c(F)cc(F)c(C(=O)O)c1F.
What is the InChIKey of 3-but-2-enyl-2,4,6-trifluorobenzoic acid?
The InChIKey is IAVUSPSLQXBXKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9F3O2/c1-2-3-4-6-7(12)5-8(13)9(10(6)14)11(15)16/h2-3,5H,4H2,1H3,(H,15,16).
What are the key properties of 3-but-2-enyl-2,4,6-trifluorobenzoic acid?
3-but-2-enyl-2,4,6-trifluorobenzoic acid has a molecular weight of 230.18 g/mol, XLogP of 2.92, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-but-2-enyl-2,4,6-trifluorobenzoic acid is sourced from PubChem (CID 173080788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).