About propan-2-yloxy-[2,4,5-tris(propan-2-yloxysilyl)phenyl]silane
propan-2-yloxy-[2,4,5-tris(propan-2-yloxysilyl)phenyl]silane (PubChem CID 173081538) has the molecular formula C18H38O4Si4
and a molecular weight of 430.84 g/mol. Its IUPAC name is propan-2-yloxy-[2,4,5-tris(propan-2-yloxysilyl)phenyl]silane.
Molecular Properties
| Compound Name | propan-2-yloxy-[2,4,5-tris(propan-2-yloxysilyl)phenyl]silane |
| PubChem CID | 173081538 |
| Molecular Formula | C18H38O4Si4 |
| Molecular Weight | 430.84 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | propan-2-yloxy-[2,4,5-tris(propan-2-yloxysilyl)phenyl]silane |
| SMILES | CC(C)O[SiH2]c1cc([SiH2]OC(C)C)c([SiH2]OC(C)C)cc1[SiH2]OC(C)C |
| InChI | InChI=1S/C18H38O4Si4/c1-11(2)19-23-15-9-17(25-21-13(5)6)18(26-22-14(7)8)10-16(15)24-20-12(3)4/h9-14H,23-26H2,1-8H3 |
| InChIKey | WNIBFKKJAPZQQL-UHFFFAOYSA-N |
| XLogP | -1.78 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 430.84 |
| LogP ≤ 5 | -1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze propan-2-yloxy-[2,4,5-tris(propan-2-yloxysilyl)phenyl]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yloxy-[2,4,5-tris(propan-2-yloxysilyl)phenyl]silane?
The IUPAC name of propan-2-yloxy-[2,4,5-tris(propan-2-yloxysilyl)phenyl]silane (CID 173081538) is propan-2-yloxy-[2,4,5-tris(propan-2-yloxysilyl)phenyl]silane.
What is the SMILES notation for propan-2-yloxy-[2,4,5-tris(propan-2-yloxysilyl)phenyl]silane?
The canonical SMILES for propan-2-yloxy-[2,4,5-tris(propan-2-yloxysilyl)phenyl]silane is CC(C)O[SiH2]c1cc([SiH2]OC(C)C)c([SiH2]OC(C)C)cc1[SiH2]OC(C)C.
What is the InChIKey of propan-2-yloxy-[2,4,5-tris(propan-2-yloxysilyl)phenyl]silane?
The InChIKey is WNIBFKKJAPZQQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H38O4Si4/c1-11(2)19-23-15-9-17(25-21-13(5)6)18(26-22-14(7)8)10-16(15)24-20-12(3)4/h9-14H,23-26H2,1-8H3.
What are the key properties of propan-2-yloxy-[2,4,5-tris(propan-2-yloxysilyl)phenyl]silane?
propan-2-yloxy-[2,4,5-tris(propan-2-yloxysilyl)phenyl]silane has a molecular weight of 430.84 g/mol, XLogP of -1.78, 12 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yloxy-[2,4,5-tris(propan-2-yloxysilyl)phenyl]silane is sourced from PubChem (CID 173081538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).