About CID 173081952
CID 173081952 (PubChem CID 173081952) has the molecular formula C10H20N2Te+
and a molecular weight of 295.88 g/mol.
Molecular Properties
| Compound Name | CID 173081952 |
| PubChem CID | 173081952 |
| Molecular Formula | C10H20N2Te+ |
| Molecular Weight | 295.88 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | — |
| SMILES | C1CCN([Te+]N2CCCCC2)CC1 |
| InChI | InChI=1S/C10H20N2Te/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h1-10H2/q+1 |
| InChIKey | HHJRHCKYNMTYCJ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.88 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 173081952 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 173081952?
The IUPAC name of CID 173081952 (CID 173081952) is not available.
What is the SMILES notation for CID 173081952?
The canonical SMILES for CID 173081952 is C1CCN([Te+]N2CCCCC2)CC1.
What is the InChIKey of CID 173081952?
The InChIKey is HHJRHCKYNMTYCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2Te/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h1-10H2/q+1.
What are the key properties of CID 173081952?
CID 173081952 has a molecular weight of 295.88 g/mol, XLogP of 1.49, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 173081952 is sourced from PubChem (CID 173081952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).