About lithium;hydride;1-(6-methoxy-3-pyridinyl)-5-pyridazin-3-ylpyrazole-3-carboxylic acid
lithium;hydride;1-(6-methoxy-3-pyridinyl)-5-pyridazin-3-ylpyrazole-3-carboxylic acid (PubChem CID 173083048) has the molecular formula C14H12LiN5O3
and a molecular weight of 305.22 g/mol. Its IUPAC name is lithium;hydride;1-(6-methoxy-3-pyridinyl)-5-pyridazin-3-ylpyrazole-3-carboxylic acid.
Molecular Properties
| Compound Name | lithium;hydride;1-(6-methoxy-3-pyridinyl)-5-pyridazin-3-ylpyrazole-3-carboxylic acid |
| PubChem CID | 173083048 |
| Molecular Formula | C14H12LiN5O3 |
| Molecular Weight | 305.22 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | lithium;hydride;1-(6-methoxy-3-pyridinyl)-5-pyridazin-3-ylpyrazole-3-carboxylic acid |
| SMILES | COc1ccc(-n2nc(C(=O)O)cc2-c2cccnn2)cn1.[H-].[Li+] |
| InChI | InChI=1S/C14H11N5O3.Li.H/c1-22-13-5-4-9(8-15-13)19-12(7-11(18-19)14(20)21)10-3-2-6-16-17-10;;/h2-8H,1H3,(H,20,21);;/q;+1;-1 |
| InChIKey | CSCZTKBOHQCIKX-UHFFFAOYSA-N |
| XLogP | -1.45 |
| TPSA | 103.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.22 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze lithium;hydride;1-(6-methoxy-3-pyridinyl)-5-pyridazin-3-ylpyrazole-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;hydride;1-(6-methoxy-3-pyridinyl)-5-pyridazin-3-ylpyrazole-3-carboxylic acid?
The IUPAC name of lithium;hydride;1-(6-methoxy-3-pyridinyl)-5-pyridazin-3-ylpyrazole-3-carboxylic acid (CID 173083048) is lithium;hydride;1-(6-methoxy-3-pyridinyl)-5-pyridazin-3-ylpyrazole-3-carboxylic acid.
What is the SMILES notation for lithium;hydride;1-(6-methoxy-3-pyridinyl)-5-pyridazin-3-ylpyrazole-3-carboxylic acid?
The canonical SMILES for lithium;hydride;1-(6-methoxy-3-pyridinyl)-5-pyridazin-3-ylpyrazole-3-carboxylic acid is COc1ccc(-n2nc(C(=O)O)cc2-c2cccnn2)cn1.[H-].[Li+].
What is the InChIKey of lithium;hydride;1-(6-methoxy-3-pyridinyl)-5-pyridazin-3-ylpyrazole-3-carboxylic acid?
The InChIKey is CSCZTKBOHQCIKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11N5O3.Li.H/c1-22-13-5-4-9(8-15-13)19-12(7-11(18-19)14(20)21)10-3-2-6-16-17-10;;/h2-8H,1H3,(H,20,21);;/q;+1;-1.
What are the key properties of lithium;hydride;1-(6-methoxy-3-pyridinyl)-5-pyridazin-3-ylpyrazole-3-carboxylic acid?
lithium;hydride;1-(6-methoxy-3-pyridinyl)-5-pyridazin-3-ylpyrazole-3-carboxylic acid has a molecular weight of 305.22 g/mol, XLogP of -1.45, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;hydride;1-(6-methoxy-3-pyridinyl)-5-pyridazin-3-ylpyrazole-3-carboxylic acid is sourced from PubChem (CID 173083048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).