About 2-butyl-1-ethylimidazole;hydrochloride
2-butyl-1-ethylimidazole;hydrochloride (PubChem CID 173083631) has the molecular formula C9H17ClN2
and a molecular weight of 188.70 g/mol. Its IUPAC name is 2-butyl-1-ethylimidazole;hydrochloride.
Molecular Properties
| Compound Name | 2-butyl-1-ethylimidazole;hydrochloride |
| PubChem CID | 173083631 |
| Molecular Formula | C9H17ClN2 |
| Molecular Weight | 188.70 g/mol |
| Exact Mass | 188.11 |
| IUPAC Name | 2-butyl-1-ethylimidazole;hydrochloride |
| SMILES | CCCCc1nccn1CC.Cl |
| InChI | InChI=1S/C9H16N2.ClH/c1-3-5-6-9-10-7-8-11(9)4-2;/h7-8H,3-6H2,1-2H3;1H |
| InChIKey | ZOBFNPXVDJWCLR-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.70 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-butyl-1-ethylimidazole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyl-1-ethylimidazole;hydrochloride?
The IUPAC name of 2-butyl-1-ethylimidazole;hydrochloride (CID 173083631) is 2-butyl-1-ethylimidazole;hydrochloride.
What is the SMILES notation for 2-butyl-1-ethylimidazole;hydrochloride?
The canonical SMILES for 2-butyl-1-ethylimidazole;hydrochloride is CCCCc1nccn1CC.Cl.
What is the InChIKey of 2-butyl-1-ethylimidazole;hydrochloride?
The InChIKey is ZOBFNPXVDJWCLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2.ClH/c1-3-5-6-9-10-7-8-11(9)4-2;/h7-8H,3-6H2,1-2H3;1H.
What are the key properties of 2-butyl-1-ethylimidazole;hydrochloride?
2-butyl-1-ethylimidazole;hydrochloride has a molecular weight of 188.70 g/mol, XLogP of 2.67, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyl-1-ethylimidazole;hydrochloride is sourced from PubChem (CID 173083631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).