C20H46ClNO3Si — CID 173083767
N,N-dimethyl-6-trimethoxysilylpentadecan-4-amine;hydrochloride (PubChem CID 173083767) has the molecular formula C20H46ClNO3Si and a molecular weight of 412.13 g/mol. Its IUPAC name is N,N-dimethyl-6-trimethoxysilylpentadecan-4-amine;hydrochloride.
| Compound Name | N,N-dimethyl-6-trimethoxysilylpentadecan-4-amine;hydrochloride |
|---|---|
| PubChem CID | 173083767 |
| Molecular Formula | C20H46ClNO3Si |
| Molecular Weight | 412.13 g/mol |
| Exact Mass | 411.29 |
| IUPAC Name | N,N-dimethyl-6-trimethoxysilylpentadecan-4-amine;hydrochloride |
| SMILES | CCCCCCCCCC(CC(CCC)N(C)C)[Si](OC)(OC)OC.Cl |
| InChI | InChI=1S/C20H45NO3Si.ClH/c1-8-10-11-12-13-14-15-17-20(25(22-5,23-6)24-7)18-19(16-9-2)21(3)4;/h19-20H,8-18H2,1-7H3;1H |
| InChIKey | HVMRTOBZQATMEY-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.13 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|