C21H28BrN3O2 — CID 173084007
13,15-diazabicyclo[10.2.1]pentadeca-1(14),12-diene;isoindole-1,3-dione;hydrobromide (PubChem CID 173084007) has the molecular formula C21H28BrN3O2 and a molecular weight of 434.38 g/mol. Its IUPAC name is 13,15-diazabicyclo[10.2.1]pentadeca-1(14),12-diene;isoindole-1,3-dione;hydrobromide.
| Compound Name | 13,15-diazabicyclo[10.2.1]pentadeca-1(14),12-diene;isoindole-1,3-dione;hydrobromide |
|---|---|
| PubChem CID | 173084007 |
| Molecular Formula | C21H28BrN3O2 |
| Molecular Weight | 434.38 g/mol |
| Exact Mass | 433.14 |
| IUPAC Name | 13,15-diazabicyclo[10.2.1]pentadeca-1(14),12-diene;isoindole-1,3-dione;hydrobromide |
| SMILES | Br.O=C1NC(=O)c2ccccc21.c1nc2[nH]c1CCCCCCCCCC2 |
| InChI | InChI=1S/C13H22N2.C8H5NO2.BrH/c1-2-4-6-8-10-13-14-11-12(15-13)9-7-5-3-1;10-7-5-3-1-2-4-6(5)8(11)9-7;/h11H,1-10H2,(H,14,15);1-4H,(H,9,10,11);1H |
| InChIKey | KDESXHPORNLDEI-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.38 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|