About 2-(4-methyl-2H-1,3-thiazol-3-yl)acetamide;hydrobromide
2-(4-methyl-2H-1,3-thiazol-3-yl)acetamide;hydrobromide (PubChem CID 173084029) has the molecular formula C6H11BrN2OS
and a molecular weight of 239.14 g/mol. Its IUPAC name is 2-(4-methyl-2H-1,3-thiazol-3-yl)acetamide;hydrobromide.
Molecular Properties
| Compound Name | 2-(4-methyl-2H-1,3-thiazol-3-yl)acetamide;hydrobromide |
| PubChem CID | 173084029 |
| Molecular Formula | C6H11BrN2OS |
| Molecular Weight | 239.14 g/mol |
| Exact Mass | 237.98 |
| IUPAC Name | 2-(4-methyl-2H-1,3-thiazol-3-yl)acetamide;hydrobromide |
| SMILES | Br.CC1=CSCN1CC(N)=O |
| InChI | InChI=1S/C6H10N2OS.BrH/c1-5-3-10-4-8(5)2-6(7)9;/h3H,2,4H2,1H3,(H2,7,9);1H |
| InChIKey | NOCCCXRGQXMCMU-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.14 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(4-methyl-2H-1,3-thiazol-3-yl)acetamide;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methyl-2H-1,3-thiazol-3-yl)acetamide;hydrobromide?
The IUPAC name of 2-(4-methyl-2H-1,3-thiazol-3-yl)acetamide;hydrobromide (CID 173084029) is 2-(4-methyl-2H-1,3-thiazol-3-yl)acetamide;hydrobromide.
What is the SMILES notation for 2-(4-methyl-2H-1,3-thiazol-3-yl)acetamide;hydrobromide?
The canonical SMILES for 2-(4-methyl-2H-1,3-thiazol-3-yl)acetamide;hydrobromide is Br.CC1=CSCN1CC(N)=O.
What is the InChIKey of 2-(4-methyl-2H-1,3-thiazol-3-yl)acetamide;hydrobromide?
The InChIKey is NOCCCXRGQXMCMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2OS.BrH/c1-5-3-10-4-8(5)2-6(7)9;/h3H,2,4H2,1H3,(H2,7,9);1H.
What are the key properties of 2-(4-methyl-2H-1,3-thiazol-3-yl)acetamide;hydrobromide?
2-(4-methyl-2H-1,3-thiazol-3-yl)acetamide;hydrobromide has a molecular weight of 239.14 g/mol, XLogP of 0.92, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methyl-2H-1,3-thiazol-3-yl)acetamide;hydrobromide is sourced from PubChem (CID 173084029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).