C25H46N4O4 — CID 173084675
2-[[(Z)-but-2-enoyl]-ethylamino]-N,N-dimethylbutanamide;2-[but-2-enoyl(propyl)amino]-N,N-dimethylbutanamide (PubChem CID 173084675) has the molecular formula C25H46N4O4 and a molecular weight of 466.67 g/mol. Its IUPAC name is 2-[[(Z)-but-2-enoyl]-ethylamino]-N,N-dimethylbutanamide;2-[but-2-enoyl(propyl)amino]-N,N-dimethylbutanamide.
| Compound Name | 2-[[(Z)-but-2-enoyl]-ethylamino]-N,N-dimethylbutanamide;2-[but-2-enoyl(propyl)amino]-N,N-dimethylbutanamide |
|---|---|
| PubChem CID | 173084675 |
| Molecular Formula | C25H46N4O4 |
| Molecular Weight | 466.67 g/mol |
| Exact Mass | 466.35 |
| IUPAC Name | 2-[[(Z)-but-2-enoyl]-ethylamino]-N,N-dimethylbutanamide;2-[but-2-enoyl(propyl)amino]-N,N-dimethylbutanamide |
| SMILES | C/C=C\C(=O)N(CC)C(CC)C(=O)N(C)C.CC=CC(=O)N(CCC)C(CC)C(=O)N(C)C |
| InChI | InChI=1S/C13H24N2O2.C12H22N2O2/c1-6-9-12(16)15(10-7-2)11(8-3)13(17)14(4)5;1-6-9-11(15)14(8-3)10(7-2)12(16)13(4)5/h6,9,11H,7-8,10H2,1-5H3;6,9-10H,7-8H2,1-5H3/b;9-6- |
| InChIKey | ZDHWSRRZUPRQBD-UGCXORAOSA-N |
| XLogP | 2.95 |
| TPSA | 81.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.67 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|