About 4-chloro-2,3-dipropyl-1H-indene
4-chloro-2,3-dipropyl-1H-indene (PubChem CID 173085073) has the molecular formula C15H19Cl
and a molecular weight of 234.77 g/mol. Its IUPAC name is 4-chloro-2,3-dipropyl-1H-indene.
Molecular Properties
| Compound Name | 4-chloro-2,3-dipropyl-1H-indene |
| PubChem CID | 173085073 |
| Molecular Formula | C15H19Cl |
| Molecular Weight | 234.77 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | 4-chloro-2,3-dipropyl-1H-indene |
| SMILES | CCCC1=C(CCC)c2c(Cl)cccc2C1 |
| InChI | InChI=1S/C15H19Cl/c1-3-6-11-10-12-8-5-9-14(16)15(12)13(11)7-4-2/h5,8-9H,3-4,6-7,10H2,1-2H3 |
| InChIKey | LWVFNNARGDQEJB-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 234.77 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 4-chloro-2,3-dipropyl-1H-indene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2,3-dipropyl-1H-indene?
The IUPAC name of 4-chloro-2,3-dipropyl-1H-indene (CID 173085073) is 4-chloro-2,3-dipropyl-1H-indene.
What is the SMILES notation for 4-chloro-2,3-dipropyl-1H-indene?
The canonical SMILES for 4-chloro-2,3-dipropyl-1H-indene is CCCC1=C(CCC)c2c(Cl)cccc2C1.
What is the InChIKey of 4-chloro-2,3-dipropyl-1H-indene?
The InChIKey is LWVFNNARGDQEJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19Cl/c1-3-6-11-10-12-8-5-9-14(16)15(12)13(11)7-4-2/h5,8-9H,3-4,6-7,10H2,1-2H3.
What are the key properties of 4-chloro-2,3-dipropyl-1H-indene?
4-chloro-2,3-dipropyl-1H-indene has a molecular weight of 234.77 g/mol, XLogP of 5.25, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2,3-dipropyl-1H-indene is sourced from PubChem (CID 173085073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).