About platinum;N,N',N'-trimethylethane-1,2-diamine;trichloride
platinum;N,N',N'-trimethylethane-1,2-diamine;trichloride (PubChem CID 173085671) has the molecular formula C5H14Cl3N2Pt-3
and a molecular weight of 403.62 g/mol. Its IUPAC name is platinum;N,N',N'-trimethylethane-1,2-diamine;trichloride.
Molecular Properties
| Compound Name | platinum;N,N',N'-trimethylethane-1,2-diamine;trichloride |
| PubChem CID | 173085671 |
| Molecular Formula | C5H14Cl3N2Pt-3 |
| Molecular Weight | 403.62 g/mol |
| Exact Mass | 401.99 |
| IUPAC Name | platinum;N,N',N'-trimethylethane-1,2-diamine;trichloride |
| SMILES | CNCCN(C)C.[Cl-].[Cl-].[Cl-].[Pt] |
| InChI | InChI=1S/C5H14N2.3ClH.Pt/c1-6-4-5-7(2)3;;;;/h6H,4-5H2,1-3H3;3*1H;/p-3 |
| InChIKey | FDALRHDWYPDXFX-UHFFFAOYSA-K |
| XLogP | -9.22 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.62 |
| LogP ≤ 5 | -9.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze platinum;N,N',N'-trimethylethane-1,2-diamine;trichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of platinum;N,N',N'-trimethylethane-1,2-diamine;trichloride?
The IUPAC name of platinum;N,N',N'-trimethylethane-1,2-diamine;trichloride (CID 173085671) is platinum;N,N',N'-trimethylethane-1,2-diamine;trichloride.
What is the SMILES notation for platinum;N,N',N'-trimethylethane-1,2-diamine;trichloride?
The canonical SMILES for platinum;N,N',N'-trimethylethane-1,2-diamine;trichloride is CNCCN(C)C.[Cl-].[Cl-].[Cl-].[Pt].
What is the InChIKey of platinum;N,N',N'-trimethylethane-1,2-diamine;trichloride?
The InChIKey is FDALRHDWYPDXFX-UHFFFAOYSA-K. The full InChI is InChI=1S/C5H14N2.3ClH.Pt/c1-6-4-5-7(2)3;;;;/h6H,4-5H2,1-3H3;3*1H;/p-3.
What are the key properties of platinum;N,N',N'-trimethylethane-1,2-diamine;trichloride?
platinum;N,N',N'-trimethylethane-1,2-diamine;trichloride has a molecular weight of 403.62 g/mol, XLogP of -9.22, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for platinum;N,N',N'-trimethylethane-1,2-diamine;trichloride is sourced from PubChem (CID 173085671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).