About 4-ethylidene-1,2-oxazolidine-3,5-dione
4-ethylidene-1,2-oxazolidine-3,5-dione (PubChem CID 173086545) has the molecular formula C5H5NO3
and a molecular weight of 127.10 g/mol. Its IUPAC name is 4-ethylidene-1,2-oxazolidine-3,5-dione.
Molecular Properties
| Compound Name | 4-ethylidene-1,2-oxazolidine-3,5-dione |
| PubChem CID | 173086545 |
| Molecular Formula | C5H5NO3 |
| Molecular Weight | 127.10 g/mol |
| Exact Mass | 127.03 |
| IUPAC Name | 4-ethylidene-1,2-oxazolidine-3,5-dione |
| SMILES | CC=C1C(=O)NOC1=O |
| InChI | InChI=1S/C5H5NO3/c1-2-3-4(7)6-9-5(3)8/h2H,1H3,(H,6,7) |
| InChIKey | MNWUPCSJFANOPN-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.10 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze 4-ethylidene-1,2-oxazolidine-3,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethylidene-1,2-oxazolidine-3,5-dione?
The IUPAC name of 4-ethylidene-1,2-oxazolidine-3,5-dione (CID 173086545) is 4-ethylidene-1,2-oxazolidine-3,5-dione.
What is the SMILES notation for 4-ethylidene-1,2-oxazolidine-3,5-dione?
The canonical SMILES for 4-ethylidene-1,2-oxazolidine-3,5-dione is CC=C1C(=O)NOC1=O.
What is the InChIKey of 4-ethylidene-1,2-oxazolidine-3,5-dione?
The InChIKey is MNWUPCSJFANOPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5NO3/c1-2-3-4(7)6-9-5(3)8/h2H,1H3,(H,6,7).
What are the key properties of 4-ethylidene-1,2-oxazolidine-3,5-dione?
4-ethylidene-1,2-oxazolidine-3,5-dione has a molecular weight of 127.10 g/mol, XLogP of -0.48, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethylidene-1,2-oxazolidine-3,5-dione is sourced from PubChem (CID 173086545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).