About cyclopropylmethyl 3,3-bis[(4-fluorophenyl)sulfanyl]-N-phenylsulfanylpropanimidate
cyclopropylmethyl 3,3-bis[(4-fluorophenyl)sulfanyl]-N-phenylsulfanylpropanimidate (PubChem CID 173087225) has the molecular formula C25H23F2NOS3
and a molecular weight of 487.66 g/mol. Its IUPAC name is cyclopropylmethyl 3,3-bis[(4-fluorophenyl)sulfanyl]-N-phenylsulfanylpropanimidate.
Molecular Properties
| Compound Name | cyclopropylmethyl 3,3-bis[(4-fluorophenyl)sulfanyl]-N-phenylsulfanylpropanimidate |
| PubChem CID | 173087225 |
| Molecular Formula | C25H23F2NOS3 |
| Molecular Weight | 487.66 g/mol |
| Exact Mass | 487.09 |
| IUPAC Name | cyclopropylmethyl 3,3-bis[(4-fluorophenyl)sulfanyl]-N-phenylsulfanylpropanimidate |
| SMILES | Fc1ccc(SC(CC(=NSc2ccccc2)OCC2CC2)Sc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C25H23F2NOS3/c26-19-8-12-21(13-9-19)30-25(31-22-14-10-20(27)11-15-22)16-24(29-17-18-6-7-18)28-32-23-4-2-1-3-5-23/h1-5,8-15,18,25H,6-7,16-17H2 |
| InChIKey | OOIJYKHHLRWEBP-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 487.66 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze cyclopropylmethyl 3,3-bis[(4-fluorophenyl)sulfanyl]-N-phenylsulfanylpropanimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopropylmethyl 3,3-bis[(4-fluorophenyl)sulfanyl]-N-phenylsulfanylpropanimidate?
The IUPAC name of cyclopropylmethyl 3,3-bis[(4-fluorophenyl)sulfanyl]-N-phenylsulfanylpropanimidate (CID 173087225) is cyclopropylmethyl 3,3-bis[(4-fluorophenyl)sulfanyl]-N-phenylsulfanylpropanimidate.
What is the SMILES notation for cyclopropylmethyl 3,3-bis[(4-fluorophenyl)sulfanyl]-N-phenylsulfanylpropanimidate?
The canonical SMILES for cyclopropylmethyl 3,3-bis[(4-fluorophenyl)sulfanyl]-N-phenylsulfanylpropanimidate is Fc1ccc(SC(CC(=NSc2ccccc2)OCC2CC2)Sc2ccc(F)cc2)cc1.
What is the InChIKey of cyclopropylmethyl 3,3-bis[(4-fluorophenyl)sulfanyl]-N-phenylsulfanylpropanimidate?
The InChIKey is OOIJYKHHLRWEBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H23F2NOS3/c26-19-8-12-21(13-9-19)30-25(31-22-14-10-20(27)11-15-22)16-24(29-17-18-6-7-18)28-32-23-4-2-1-3-5-23/h1-5,8-15,18,25H,6-7,16-17H2.
What are the key properties of cyclopropylmethyl 3,3-bis[(4-fluorophenyl)sulfanyl]-N-phenylsulfanylpropanimidate?
cyclopropylmethyl 3,3-bis[(4-fluorophenyl)sulfanyl]-N-phenylsulfanylpropanimidate has a molecular weight of 487.66 g/mol, XLogP of 8.10, 10 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropylmethyl 3,3-bis[(4-fluorophenyl)sulfanyl]-N-phenylsulfanylpropanimidate is sourced from PubChem (CID 173087225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).