C28H29Cl2NOS3 — CID 173087320
cyclohexylmethyl 3,3-bis[(4-chlorophenyl)sulfanyl]-N-phenylsulfanylpropanimidate (PubChem CID 173087320) has the molecular formula C28H29Cl2NOS3 and a molecular weight of 562.65 g/mol. Its IUPAC name is cyclohexylmethyl 3,3-bis[(4-chlorophenyl)sulfanyl]-N-phenylsulfanylpropanimidate.
| Compound Name | cyclohexylmethyl 3,3-bis[(4-chlorophenyl)sulfanyl]-N-phenylsulfanylpropanimidate |
|---|---|
| PubChem CID | 173087320 |
| Molecular Formula | C28H29Cl2NOS3 |
| Molecular Weight | 562.65 g/mol |
| Exact Mass | 561.08 |
| IUPAC Name | cyclohexylmethyl 3,3-bis[(4-chlorophenyl)sulfanyl]-N-phenylsulfanylpropanimidate |
| SMILES | Clc1ccc(SC(CC(=NSc2ccccc2)OCC2CCCCC2)Sc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C28H29Cl2NOS3/c29-22-11-15-24(16-12-22)33-28(34-25-17-13-23(30)14-18-25)19-27(31-35-26-9-5-2-6-10-26)32-20-21-7-3-1-4-8-21/h2,5-6,9-18,21,28H,1,3-4,7-8,19-20H2 |
| InChIKey | WGYFIYYKEFPCLY-UHFFFAOYSA-N |
| XLogP | 10.30 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.65 |
| LogP ≤ 5 | 10.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|