About (2-sulfanylidene-1,3-benzothiazol-3-yl)methyl 2-acetamido-4-methylsulfanylbutanoate
(2-sulfanylidene-1,3-benzothiazol-3-yl)methyl 2-acetamido-4-methylsulfanylbutanoate (PubChem CID 17308889) has the molecular formula C15H18N2O3S3
and a molecular weight of 370.52 g/mol. Its IUPAC name is (2-sulfanylidene-1,3-benzothiazol-3-yl)methyl 2-acetamido-4-methylsulfanylbutanoate.
Molecular Properties
| Compound Name | (2-sulfanylidene-1,3-benzothiazol-3-yl)methyl 2-acetamido-4-methylsulfanylbutanoate |
| PubChem CID | 17308889 |
| Molecular Formula | C15H18N2O3S3 |
| Molecular Weight | 370.52 g/mol |
| Exact Mass | 370.05 |
| IUPAC Name | (2-sulfanylidene-1,3-benzothiazol-3-yl)methyl 2-acetamido-4-methylsulfanylbutanoate |
| SMILES | CSCCC(NC(C)=O)C(=O)OCn1c(=S)sc2ccccc21 |
| InChI | InChI=1S/C15H18N2O3S3/c1-10(18)16-11(7-8-22-2)14(19)20-9-17-12-5-3-4-6-13(12)23-15(17)21/h3-6,11H,7-9H2,1-2H3,(H,16,18) |
| InChIKey | WOBGRPTVRVWGQJ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.52 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (2-sulfanylidene-1,3-benzothiazol-3-yl)methyl 2-acetamido-4-methylsulfanylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-sulfanylidene-1,3-benzothiazol-3-yl)methyl 2-acetamido-4-methylsulfanylbutanoate?
The IUPAC name of (2-sulfanylidene-1,3-benzothiazol-3-yl)methyl 2-acetamido-4-methylsulfanylbutanoate (CID 17308889) is (2-sulfanylidene-1,3-benzothiazol-3-yl)methyl 2-acetamido-4-methylsulfanylbutanoate.
What is the SMILES notation for (2-sulfanylidene-1,3-benzothiazol-3-yl)methyl 2-acetamido-4-methylsulfanylbutanoate?
The canonical SMILES for (2-sulfanylidene-1,3-benzothiazol-3-yl)methyl 2-acetamido-4-methylsulfanylbutanoate is CSCCC(NC(C)=O)C(=O)OCn1c(=S)sc2ccccc21.
What is the InChIKey of (2-sulfanylidene-1,3-benzothiazol-3-yl)methyl 2-acetamido-4-methylsulfanylbutanoate?
The InChIKey is WOBGRPTVRVWGQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2O3S3/c1-10(18)16-11(7-8-22-2)14(19)20-9-17-12-5-3-4-6-13(12)23-15(17)21/h3-6,11H,7-9H2,1-2H3,(H,16,18).
What are the key properties of (2-sulfanylidene-1,3-benzothiazol-3-yl)methyl 2-acetamido-4-methylsulfanylbutanoate?
(2-sulfanylidene-1,3-benzothiazol-3-yl)methyl 2-acetamido-4-methylsulfanylbutanoate has a molecular weight of 370.52 g/mol, XLogP of 3.19, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (2-sulfanylidene-1,3-benzothiazol-3-yl)methyl 2-acetamido-4-methylsulfanylbutanoate is sourced from PubChem (CID 17308889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).