About ethyl 4-bromo-1-(2,4-dichlorophenyl)-5-(3-pent-1-enylselenophen-2-yl)pyrazole-3-carboxylate
ethyl 4-bromo-1-(2,4-dichlorophenyl)-5-(3-pent-1-enylselenophen-2-yl)pyrazole-3-carboxylate (PubChem CID 173089123) has the molecular formula C21H19BrCl2N2O2Se
and a molecular weight of 561.17 g/mol. Its IUPAC name is ethyl 4-bromo-1-(2,4-dichlorophenyl)-5-(3-pent-1-enylselenophen-2-yl)pyrazole-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-bromo-1-(2,4-dichlorophenyl)-5-(3-pent-1-enylselenophen-2-yl)pyrazole-3-carboxylate |
| PubChem CID | 173089123 |
| Molecular Formula | C21H19BrCl2N2O2Se |
| Molecular Weight | 561.17 g/mol |
| Exact Mass | 559.92 |
| IUPAC Name | ethyl 4-bromo-1-(2,4-dichlorophenyl)-5-(3-pent-1-enylselenophen-2-yl)pyrazole-3-carboxylate |
| SMILES | CCCC=Cc1cc[se]c1-c1c(Br)c(C(=O)OCC)nn1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C21H19BrCl2N2O2Se/c1-3-5-6-7-13-10-11-29-20(13)19-17(22)18(21(27)28-4-2)25-26(19)16-9-8-14(23)12-15(16)24/h6-12H,3-5H2,1-2H3 |
| InChIKey | OISJQKXQXQAFIU-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 561.17 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-bromo-1-(2,4-dichlorophenyl)-5-(3-pent-1-enylselenophen-2-yl)pyrazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-bromo-1-(2,4-dichlorophenyl)-5-(3-pent-1-enylselenophen-2-yl)pyrazole-3-carboxylate?
The IUPAC name of ethyl 4-bromo-1-(2,4-dichlorophenyl)-5-(3-pent-1-enylselenophen-2-yl)pyrazole-3-carboxylate (CID 173089123) is ethyl 4-bromo-1-(2,4-dichlorophenyl)-5-(3-pent-1-enylselenophen-2-yl)pyrazole-3-carboxylate.
What is the SMILES notation for ethyl 4-bromo-1-(2,4-dichlorophenyl)-5-(3-pent-1-enylselenophen-2-yl)pyrazole-3-carboxylate?
The canonical SMILES for ethyl 4-bromo-1-(2,4-dichlorophenyl)-5-(3-pent-1-enylselenophen-2-yl)pyrazole-3-carboxylate is CCCC=Cc1cc[se]c1-c1c(Br)c(C(=O)OCC)nn1-c1ccc(Cl)cc1Cl.
What is the InChIKey of ethyl 4-bromo-1-(2,4-dichlorophenyl)-5-(3-pent-1-enylselenophen-2-yl)pyrazole-3-carboxylate?
The InChIKey is OISJQKXQXQAFIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19BrCl2N2O2Se/c1-3-5-6-7-13-10-11-29-20(13)19-17(22)18(21(27)28-4-2)25-26(19)16-9-8-14(23)12-15(16)24/h6-12H,3-5H2,1-2H3.
What are the key properties of ethyl 4-bromo-1-(2,4-dichlorophenyl)-5-(3-pent-1-enylselenophen-2-yl)pyrazole-3-carboxylate?
ethyl 4-bromo-1-(2,4-dichlorophenyl)-5-(3-pent-1-enylselenophen-2-yl)pyrazole-3-carboxylate has a molecular weight of 561.17 g/mol, XLogP of 6.66, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-bromo-1-(2,4-dichlorophenyl)-5-(3-pent-1-enylselenophen-2-yl)pyrazole-3-carboxylate is sourced from PubChem (CID 173089123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).