About 6-(3-dimethylsilyloxy-4,4-dimethylpentyl)-3-ethoxycyclohex-2-en-1-one
6-(3-dimethylsilyloxy-4,4-dimethylpentyl)-3-ethoxycyclohex-2-en-1-one (PubChem CID 173089364) has the molecular formula C17H32O3Si
and a molecular weight of 312.53 g/mol. Its IUPAC name is 6-(3-dimethylsilyloxy-4,4-dimethylpentyl)-3-ethoxycyclohex-2-en-1-one.
Molecular Properties
| Compound Name | 6-(3-dimethylsilyloxy-4,4-dimethylpentyl)-3-ethoxycyclohex-2-en-1-one |
| PubChem CID | 173089364 |
| Molecular Formula | C17H32O3Si |
| Molecular Weight | 312.53 g/mol |
| Exact Mass | 312.21 |
| IUPAC Name | 6-(3-dimethylsilyloxy-4,4-dimethylpentyl)-3-ethoxycyclohex-2-en-1-one |
| SMILES | CCOC1=CC(=O)C(CCC(O[SiH](C)C)C(C)(C)C)CC1 |
| InChI | InChI=1S/C17H32O3Si/c1-7-19-14-10-8-13(15(18)12-14)9-11-16(17(2,3)4)20-21(5)6/h12-13,16,21H,7-11H2,1-6H3 |
| InChIKey | TYTSYRJJSPWKAG-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.53 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 6-(3-dimethylsilyloxy-4,4-dimethylpentyl)-3-ethoxycyclohex-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3-dimethylsilyloxy-4,4-dimethylpentyl)-3-ethoxycyclohex-2-en-1-one?
The IUPAC name of 6-(3-dimethylsilyloxy-4,4-dimethylpentyl)-3-ethoxycyclohex-2-en-1-one (CID 173089364) is 6-(3-dimethylsilyloxy-4,4-dimethylpentyl)-3-ethoxycyclohex-2-en-1-one.
What is the SMILES notation for 6-(3-dimethylsilyloxy-4,4-dimethylpentyl)-3-ethoxycyclohex-2-en-1-one?
The canonical SMILES for 6-(3-dimethylsilyloxy-4,4-dimethylpentyl)-3-ethoxycyclohex-2-en-1-one is CCOC1=CC(=O)C(CCC(O[SiH](C)C)C(C)(C)C)CC1.
What is the InChIKey of 6-(3-dimethylsilyloxy-4,4-dimethylpentyl)-3-ethoxycyclohex-2-en-1-one?
The InChIKey is TYTSYRJJSPWKAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H32O3Si/c1-7-19-14-10-8-13(15(18)12-14)9-11-16(17(2,3)4)20-21(5)6/h12-13,16,21H,7-11H2,1-6H3.
What are the key properties of 6-(3-dimethylsilyloxy-4,4-dimethylpentyl)-3-ethoxycyclohex-2-en-1-one?
6-(3-dimethylsilyloxy-4,4-dimethylpentyl)-3-ethoxycyclohex-2-en-1-one has a molecular weight of 312.53 g/mol, XLogP of 4.08, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3-dimethylsilyloxy-4,4-dimethylpentyl)-3-ethoxycyclohex-2-en-1-one is sourced from PubChem (CID 173089364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).