About N-(oxan-4-yl)-1,2-dihydropyridin-2-amine
N-(oxan-4-yl)-1,2-dihydropyridin-2-amine (PubChem CID 173089456) has the molecular formula C10H16N2O
and a molecular weight of 180.25 g/mol. Its IUPAC name is N-(oxan-4-yl)-1,2-dihydropyridin-2-amine.
Molecular Properties
| Compound Name | N-(oxan-4-yl)-1,2-dihydropyridin-2-amine |
| PubChem CID | 173089456 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | N-(oxan-4-yl)-1,2-dihydropyridin-2-amine |
| SMILES | C1=CNC(NC2CCOCC2)C=C1 |
| InChI | InChI=1S/C10H16N2O/c1-2-6-11-10(3-1)12-9-4-7-13-8-5-9/h1-3,6,9-12H,4-5,7-8H2 |
| InChIKey | VDXOFULRXZVEJM-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(oxan-4-yl)-1,2-dihydropyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(oxan-4-yl)-1,2-dihydropyridin-2-amine?
The IUPAC name of N-(oxan-4-yl)-1,2-dihydropyridin-2-amine (CID 173089456) is N-(oxan-4-yl)-1,2-dihydropyridin-2-amine.
What is the SMILES notation for N-(oxan-4-yl)-1,2-dihydropyridin-2-amine?
The canonical SMILES for N-(oxan-4-yl)-1,2-dihydropyridin-2-amine is C1=CNC(NC2CCOCC2)C=C1.
What is the InChIKey of N-(oxan-4-yl)-1,2-dihydropyridin-2-amine?
The InChIKey is VDXOFULRXZVEJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O/c1-2-6-11-10(3-1)12-9-4-7-13-8-5-9/h1-3,6,9-12H,4-5,7-8H2.
What are the key properties of N-(oxan-4-yl)-1,2-dihydropyridin-2-amine?
N-(oxan-4-yl)-1,2-dihydropyridin-2-amine has a molecular weight of 180.25 g/mol, XLogP of 0.75, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(oxan-4-yl)-1,2-dihydropyridin-2-amine is sourced from PubChem (CID 173089456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).