C21H32NaO8P — CID 173089886
sodium;hydride;[(8S,9S,10R,11S,13S,14S,17R)-11-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] dihydrogen phosphate (PubChem CID 173089886) has the molecular formula C21H32NaO8P and a molecular weight of 466.44 g/mol. Its IUPAC name is sodium;hydride;[(8S,9S,10R,11S,13S,14S,17R)-11-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] dihydrogen phosphate.
| Compound Name | sodium;hydride;[(8S,9S,10R,11S,13S,14S,17R)-11-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 173089886 |
| Molecular Formula | C21H32NaO8P |
| Molecular Weight | 466.44 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | sodium;hydride;[(8S,9S,10R,11S,13S,14S,17R)-11-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] dihydrogen phosphate |
| SMILES | C[C@]12CCC(=O)C=C1CC[C@@H]1[C@@H]2[C@@H](O)C[C@@]2(C)[C@H]1CC[C@]2(OP(=O)(O)O)C(=O)CO.[H-].[Na+] |
| InChI | InChI=1S/C21H31O8P.Na.H/c1-19-7-5-13(23)9-12(19)3-4-14-15-6-8-21(17(25)11-22,29-30(26,27)28)20(15,2)10-16(24)18(14)19;;/h9,14-16,18,22,24H,3-8,10-11H2,1-2H3,(H2,26,27,28);;/q;+1;-1/t14-,15-,16-,18+,19-,20-,21-;;/m0../s1 |
| InChIKey | QOMGNRSHJNSNAC-OJJGEMKLSA-N |
| XLogP | -0.98 |
| TPSA | 141.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.44 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|