C26H19F5O5S2 — CID 173090092
2,3-bis(4-methoxyphenyl)benzenethiol;2,3,4,5,6-pentafluorobenzenesulfonic acid (PubChem CID 173090092) has the molecular formula C26H19F5O5S2 and a molecular weight of 570.56 g/mol. Its IUPAC name is 2,3-bis(4-methoxyphenyl)benzenethiol;2,3,4,5,6-pentafluorobenzenesulfonic acid.
| Compound Name | 2,3-bis(4-methoxyphenyl)benzenethiol;2,3,4,5,6-pentafluorobenzenesulfonic acid |
|---|---|
| PubChem CID | 173090092 |
| Molecular Formula | C26H19F5O5S2 |
| Molecular Weight | 570.56 g/mol |
| Exact Mass | 570.06 |
| IUPAC Name | 2,3-bis(4-methoxyphenyl)benzenethiol;2,3,4,5,6-pentafluorobenzenesulfonic acid |
| SMILES | COc1ccc(-c2cccc(S)c2-c2ccc(OC)cc2)cc1.O=S(=O)(O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C20H18O2S.C6HF5O3S/c1-21-16-10-6-14(7-11-16)18-4-3-5-19(23)20(18)15-8-12-17(22-2)13-9-15;7-1-2(8)4(10)6(15(12,13)14)5(11)3(1)9/h3-13,23H,1-2H3;(H,12,13,14) |
| InChIKey | CQRXSUDDTYJSDX-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.56 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|