About dichlorotitanium;1-[2-(9H-fluoren-9-yl)phenyl]ethanol
dichlorotitanium;1-[2-(9H-fluoren-9-yl)phenyl]ethanol (PubChem CID 173092227) has the molecular formula C21H18Cl2OTi
and a molecular weight of 405.15 g/mol. Its IUPAC name is dichlorotitanium;1-[2-(9H-fluoren-9-yl)phenyl]ethanol.
Molecular Properties
| Compound Name | dichlorotitanium;1-[2-(9H-fluoren-9-yl)phenyl]ethanol |
| PubChem CID | 173092227 |
| Molecular Formula | C21H18Cl2OTi |
| Molecular Weight | 405.15 g/mol |
| Exact Mass | 404.02 |
| IUPAC Name | dichlorotitanium;1-[2-(9H-fluoren-9-yl)phenyl]ethanol |
| SMILES | CC(O)c1ccccc1C1c2ccccc2-c2ccccc21.Cl[Ti]Cl |
| InChI | InChI=1S/C21H18O.2ClH.Ti/c1-14(22)15-8-2-5-11-18(15)21-19-12-6-3-9-16(19)17-10-4-7-13-20(17)21;;;/h2-14,21-22H,1H3;2*1H;/q;;;+2/p-2 |
| InChIKey | GADWJDXRUVVWOI-UHFFFAOYSA-L |
| XLogP | 6.28 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 405.15 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze dichlorotitanium;1-[2-(9H-fluoren-9-yl)phenyl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichlorotitanium;1-[2-(9H-fluoren-9-yl)phenyl]ethanol?
The IUPAC name of dichlorotitanium;1-[2-(9H-fluoren-9-yl)phenyl]ethanol (CID 173092227) is dichlorotitanium;1-[2-(9H-fluoren-9-yl)phenyl]ethanol.
What is the SMILES notation for dichlorotitanium;1-[2-(9H-fluoren-9-yl)phenyl]ethanol?
The canonical SMILES for dichlorotitanium;1-[2-(9H-fluoren-9-yl)phenyl]ethanol is CC(O)c1ccccc1C1c2ccccc2-c2ccccc21.Cl[Ti]Cl.
What is the InChIKey of dichlorotitanium;1-[2-(9H-fluoren-9-yl)phenyl]ethanol?
The InChIKey is GADWJDXRUVVWOI-UHFFFAOYSA-L. The full InChI is InChI=1S/C21H18O.2ClH.Ti/c1-14(22)15-8-2-5-11-18(15)21-19-12-6-3-9-16(19)17-10-4-7-13-20(17)21;;;/h2-14,21-22H,1H3;2*1H;/q;;;+2/p-2.
What are the key properties of dichlorotitanium;1-[2-(9H-fluoren-9-yl)phenyl]ethanol?
dichlorotitanium;1-[2-(9H-fluoren-9-yl)phenyl]ethanol has a molecular weight of 405.15 g/mol, XLogP of 6.28, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dichlorotitanium;1-[2-(9H-fluoren-9-yl)phenyl]ethanol is sourced from PubChem (CID 173092227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).