C23H28N4O5S — CID 173092638
3-[(1R,2S,7R,8S)-6-hydroxy-3-(3-methylbutyl)-4-oxo-3-azatricyclo[6.2.1.02,7]undec-5-en-5-yl]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazine-5-carboxamide (PubChem CID 173092638) has the molecular formula C23H28N4O5S and a molecular weight of 472.57 g/mol. Its IUPAC name is 3-[(1R,2S,7R,8S)-6-hydroxy-3-(3-methylbutyl)-4-oxo-3-azatricyclo[6.2.1.02,7]undec-5-en-5-yl]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazine-5-carboxamide.
| Compound Name | 3-[(1R,2S,7R,8S)-6-hydroxy-3-(3-methylbutyl)-4-oxo-3-azatricyclo[6.2.1.02,7]undec-5-en-5-yl]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazine-5-carboxamide |
|---|---|
| PubChem CID | 173092638 |
| Molecular Formula | C23H28N4O5S |
| Molecular Weight | 472.57 g/mol |
| Exact Mass | 472.18 |
| IUPAC Name | 3-[(1R,2S,7R,8S)-6-hydroxy-3-(3-methylbutyl)-4-oxo-3-azatricyclo[6.2.1.02,7]undec-5-en-5-yl]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazine-5-carboxamide |
| SMILES | CC(C)CCN1C(=O)C(C2=NS(=O)(=O)c3cccc(C(N)=O)c3N2)=C(O)[C@@H]2[C@H]3CC[C@H](C3)[C@@H]21 |
| InChI | InChI=1S/C23H28N4O5S/c1-11(2)8-9-27-19-13-7-6-12(10-13)16(19)20(28)17(23(27)30)22-25-18-14(21(24)29)4-3-5-15(18)33(31,32)26-22/h3-5,11-13,16,19,28H,6-10H2,1-2H3,(H2,24,29)(H,25,26)/t12-,13+,16+,19-/m0/s1 |
| InChIKey | XQBLKROOISFNQA-CFNLKKDLSA-N |
| XLogP | 2.41 |
| TPSA | 142.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.57 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |