About sodium;4-(4-amino-2,3-dimethylphenyl)-2,3-dimethylaniline;hydride
sodium;4-(4-amino-2,3-dimethylphenyl)-2,3-dimethylaniline;hydride (PubChem CID 173092762) has the molecular formula C16H21N2Na
and a molecular weight of 264.35 g/mol. Its IUPAC name is sodium;4-(4-amino-2,3-dimethylphenyl)-2,3-dimethylaniline;hydride.
Molecular Properties
| Compound Name | sodium;4-(4-amino-2,3-dimethylphenyl)-2,3-dimethylaniline;hydride |
| PubChem CID | 173092762 |
| Molecular Formula | C16H21N2Na |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | sodium;4-(4-amino-2,3-dimethylphenyl)-2,3-dimethylaniline;hydride |
| SMILES | Cc1c(N)ccc(-c2ccc(N)c(C)c2C)c1C.[H-].[Na+] |
| InChI | InChI=1S/C16H20N2.Na.H/c1-9-11(3)15(17)7-5-13(9)14-6-8-16(18)12(4)10(14)2;;/h5-8H,17-18H2,1-4H3;;/q;+1;-1 |
| InChIKey | CHADFWUGIUMPGG-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze sodium;4-(4-amino-2,3-dimethylphenyl)-2,3-dimethylaniline;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;4-(4-amino-2,3-dimethylphenyl)-2,3-dimethylaniline;hydride?
The IUPAC name of sodium;4-(4-amino-2,3-dimethylphenyl)-2,3-dimethylaniline;hydride (CID 173092762) is sodium;4-(4-amino-2,3-dimethylphenyl)-2,3-dimethylaniline;hydride.
What is the SMILES notation for sodium;4-(4-amino-2,3-dimethylphenyl)-2,3-dimethylaniline;hydride?
The canonical SMILES for sodium;4-(4-amino-2,3-dimethylphenyl)-2,3-dimethylaniline;hydride is Cc1c(N)ccc(-c2ccc(N)c(C)c2C)c1C.[H-].[Na+].
What is the InChIKey of sodium;4-(4-amino-2,3-dimethylphenyl)-2,3-dimethylaniline;hydride?
The InChIKey is CHADFWUGIUMPGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N2.Na.H/c1-9-11(3)15(17)7-5-13(9)14-6-8-16(18)12(4)10(14)2;;/h5-8H,17-18H2,1-4H3;;/q;+1;-1.
What are the key properties of sodium;4-(4-amino-2,3-dimethylphenyl)-2,3-dimethylaniline;hydride?
sodium;4-(4-amino-2,3-dimethylphenyl)-2,3-dimethylaniline;hydride has a molecular weight of 264.35 g/mol, XLogP of 0.87, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;4-(4-amino-2,3-dimethylphenyl)-2,3-dimethylaniline;hydride is sourced from PubChem (CID 173092762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).