C15H13F5 — CID 173093179
1,2,3,4,5-pentafluoro-6-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)benzene (PubChem CID 173093179) has the molecular formula C15H13F5 and a molecular weight of 288.26 g/mol. Its IUPAC name is 1,2,3,4,5-pentafluoro-6-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)benzene.
| Compound Name | 1,2,3,4,5-pentafluoro-6-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)benzene |
|---|---|
| PubChem CID | 173093179 |
| Molecular Formula | C15H13F5 |
| Molecular Weight | 288.26 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 1,2,3,4,5-pentafluoro-6-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)benzene |
| SMILES | CC1=C(C)C(C)C(c2c(F)c(F)c(F)c(F)c2F)=C1C |
| InChI | InChI=1S/C15H13F5/c1-5-6(2)8(4)9(7(5)3)10-11(16)13(18)15(20)14(19)12(10)17/h7H,1-4H3 |
| InChIKey | NTGTUTZYYJLBJZ-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.26 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|