About CID 173093326
CID 173093326 (PubChem CID 173093326) has the molecular formula H13NOSi4
and a molecular weight of 155.45 g/mol.
Molecular Properties
| Compound Name | CID 173093326 |
| PubChem CID | 173093326 |
| Molecular Formula | H13NOSi4 |
| Molecular Weight | 155.45 g/mol |
| Exact Mass | 155.01 |
| IUPAC Name | — |
| SMILES | [SiH3]N[SiH3].[SiH3]O[SiH3] |
| InChI | InChI=1S/H7NSi2.H6OSi2/c2*2-1-3/h1H,2-3H3;2-3H3 |
| InChIKey | RPQWNVNIDYUSLZ-UHFFFAOYSA-N |
| XLogP | -5.30 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.45 |
| LogP ≤ 5 | -5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 173093326 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 173093326?
The IUPAC name of CID 173093326 (CID 173093326) is not available.
What is the SMILES notation for CID 173093326?
The canonical SMILES for CID 173093326 is [SiH3]N[SiH3].[SiH3]O[SiH3].
What is the InChIKey of CID 173093326?
The InChIKey is RPQWNVNIDYUSLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/H7NSi2.H6OSi2/c2*2-1-3/h1H,2-3H3;2-3H3.
What are the key properties of CID 173093326?
CID 173093326 has a molecular weight of 155.45 g/mol, XLogP of -5.30, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 173093326 is sourced from PubChem (CID 173093326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).