C16H20FN3O3 — CID 173093781
N'-[1-[3-(4-fluorophenyl)propanoyl]piperidin-4-yl]oxamide (PubChem CID 173093781) has the molecular formula C16H20FN3O3 and a molecular weight of 321.35 g/mol. Its IUPAC name is N'-[1-[3-(4-fluorophenyl)propanoyl]piperidin-4-yl]oxamide.
| Compound Name | N'-[1-[3-(4-fluorophenyl)propanoyl]piperidin-4-yl]oxamide |
|---|---|
| PubChem CID | 173093781 |
| Molecular Formula | C16H20FN3O3 |
| Molecular Weight | 321.35 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | N'-[1-[3-(4-fluorophenyl)propanoyl]piperidin-4-yl]oxamide |
| SMILES | NC(=O)C(=O)NC1CCN(C(=O)CCc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C16H20FN3O3/c17-12-4-1-11(2-5-12)3-6-14(21)20-9-7-13(8-10-20)19-16(23)15(18)22/h1-2,4-5,13H,3,6-10H2,(H2,18,22)(H,19,23) |
| InChIKey | KBWWALVYTDFWNU-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.35 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|