About sodium;hydride;4-methyl-2H-chromene
sodium;hydride;4-methyl-2H-chromene (PubChem CID 173094334) has the molecular formula C10H11NaO
and a molecular weight of 170.19 g/mol. Its IUPAC name is sodium;hydride;4-methyl-2H-chromene.
Molecular Properties
| Compound Name | sodium;hydride;4-methyl-2H-chromene |
| PubChem CID | 173094334 |
| Molecular Formula | C10H11NaO |
| Molecular Weight | 170.19 g/mol |
| Exact Mass | 170.07 |
| IUPAC Name | sodium;hydride;4-methyl-2H-chromene |
| SMILES | CC1=CCOc2ccccc21.[H-].[Na+] |
| InChI | InChI=1S/C10H10O.Na.H/c1-8-6-7-11-10-5-3-2-4-9(8)10;;/h2-6H,7H2,1H3;;/q;+1;-1 |
| InChIKey | RAFKSWOLENVILT-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.19 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze sodium;hydride;4-methyl-2H-chromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;4-methyl-2H-chromene?
The IUPAC name of sodium;hydride;4-methyl-2H-chromene (CID 173094334) is sodium;hydride;4-methyl-2H-chromene.
What is the SMILES notation for sodium;hydride;4-methyl-2H-chromene?
The canonical SMILES for sodium;hydride;4-methyl-2H-chromene is CC1=CCOc2ccccc21.[H-].[Na+].
What is the InChIKey of sodium;hydride;4-methyl-2H-chromene?
The InChIKey is RAFKSWOLENVILT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O.Na.H/c1-8-6-7-11-10-5-3-2-4-9(8)10;;/h2-6H,7H2,1H3;;/q;+1;-1.
What are the key properties of sodium;hydride;4-methyl-2H-chromene?
sodium;hydride;4-methyl-2H-chromene has a molecular weight of 170.19 g/mol, XLogP of -0.40, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;4-methyl-2H-chromene is sourced from PubChem (CID 173094334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).