C10H17Br2NOSSi — CID 173095524
[1-(2,4-dibromo-1,3-thiazol-5-yl)-2,2-dimethylpropoxy]-dimethylsilane (PubChem CID 173095524) has the molecular formula C10H17Br2NOSSi and a molecular weight of 387.21 g/mol. Its IUPAC name is [1-(2,4-dibromo-1,3-thiazol-5-yl)-2,2-dimethylpropoxy]-dimethylsilane.
| Compound Name | [1-(2,4-dibromo-1,3-thiazol-5-yl)-2,2-dimethylpropoxy]-dimethylsilane |
|---|---|
| PubChem CID | 173095524 |
| Molecular Formula | C10H17Br2NOSSi |
| Molecular Weight | 387.21 g/mol |
| Exact Mass | 384.92 |
| IUPAC Name | [1-(2,4-dibromo-1,3-thiazol-5-yl)-2,2-dimethylpropoxy]-dimethylsilane |
| SMILES | C[SiH](C)OC(c1sc(Br)nc1Br)C(C)(C)C |
| InChI | InChI=1S/C10H17Br2NOSSi/c1-10(2,3)7(14-16(4)5)6-8(11)13-9(12)15-6/h7,16H,1-5H3 |
| InChIKey | KSATWHILRAITNB-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.21 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|