About buta-1,3-diene;disilyloxysilane
buta-1,3-diene;disilyloxysilane (PubChem CID 173095984) has the molecular formula C4H14O2Si3
and a molecular weight of 178.41 g/mol. Its IUPAC name is buta-1,3-diene;disilyloxysilane.
Molecular Properties
| Compound Name | buta-1,3-diene;disilyloxysilane |
| PubChem CID | 173095984 |
| Molecular Formula | C4H14O2Si3 |
| Molecular Weight | 178.41 g/mol |
| Exact Mass | 178.03 |
| IUPAC Name | buta-1,3-diene;disilyloxysilane |
| SMILES | C=CC=C.[SiH3]O[SiH2]O[SiH3] |
| InChI | InChI=1S/C4H6.H8O2Si3/c1-3-4-2;3-1-5-2-4/h3-4H,1-2H2;5H2,3-4H3 |
| InChIKey | VWISZBFCNHXBNA-UHFFFAOYSA-N |
| XLogP | -2.06 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.41 |
| LogP ≤ 5 | -2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze buta-1,3-diene;disilyloxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of buta-1,3-diene;disilyloxysilane?
The IUPAC name of buta-1,3-diene;disilyloxysilane (CID 173095984) is buta-1,3-diene;disilyloxysilane.
What is the SMILES notation for buta-1,3-diene;disilyloxysilane?
The canonical SMILES for buta-1,3-diene;disilyloxysilane is C=CC=C.[SiH3]O[SiH2]O[SiH3].
What is the InChIKey of buta-1,3-diene;disilyloxysilane?
The InChIKey is VWISZBFCNHXBNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6.H8O2Si3/c1-3-4-2;3-1-5-2-4/h3-4H,1-2H2;5H2,3-4H3.
What are the key properties of buta-1,3-diene;disilyloxysilane?
buta-1,3-diene;disilyloxysilane has a molecular weight of 178.41 g/mol, XLogP of -2.06, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for buta-1,3-diene;disilyloxysilane is sourced from PubChem (CID 173095984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).