About buta-1,3-diene;silyloxy(silyloxysilyloxy)silane
buta-1,3-diene;silyloxy(silyloxysilyloxy)silane (PubChem CID 173096007) has the molecular formula C4H16O3Si4
and a molecular weight of 224.51 g/mol. Its IUPAC name is buta-1,3-diene;silyloxy(silyloxysilyloxy)silane.
Molecular Properties
| Compound Name | buta-1,3-diene;silyloxy(silyloxysilyloxy)silane |
| PubChem CID | 173096007 |
| Molecular Formula | C4H16O3Si4 |
| Molecular Weight | 224.51 g/mol |
| Exact Mass | 224.02 |
| IUPAC Name | buta-1,3-diene;silyloxy(silyloxysilyloxy)silane |
| SMILES | C=CC=C.[SiH3]O[SiH2]O[SiH2]O[SiH3] |
| InChI | InChI=1S/C4H6.H10O3Si4/c1-3-4-2;4-1-6-3-7-2-5/h3-4H,1-2H2;6-7H2,4-5H3 |
| InChIKey | PUDMEUDCIIUUDG-UHFFFAOYSA-N |
| XLogP | -3.05 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.51 |
| LogP ≤ 5 | -3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze buta-1,3-diene;silyloxy(silyloxysilyloxy)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of buta-1,3-diene;silyloxy(silyloxysilyloxy)silane?
The IUPAC name of buta-1,3-diene;silyloxy(silyloxysilyloxy)silane (CID 173096007) is buta-1,3-diene;silyloxy(silyloxysilyloxy)silane.
What is the SMILES notation for buta-1,3-diene;silyloxy(silyloxysilyloxy)silane?
The canonical SMILES for buta-1,3-diene;silyloxy(silyloxysilyloxy)silane is C=CC=C.[SiH3]O[SiH2]O[SiH2]O[SiH3].
What is the InChIKey of buta-1,3-diene;silyloxy(silyloxysilyloxy)silane?
The InChIKey is PUDMEUDCIIUUDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6.H10O3Si4/c1-3-4-2;4-1-6-3-7-2-5/h3-4H,1-2H2;6-7H2,4-5H3.
What are the key properties of buta-1,3-diene;silyloxy(silyloxysilyloxy)silane?
buta-1,3-diene;silyloxy(silyloxysilyloxy)silane has a molecular weight of 224.51 g/mol, XLogP of -3.05, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for buta-1,3-diene;silyloxy(silyloxysilyloxy)silane is sourced from PubChem (CID 173096007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).