About 2-ethyl-2-(3-methylbut-2-enyl)hex-3-en-1-ol;undec-2-en-1-ol
2-ethyl-2-(3-methylbut-2-enyl)hex-3-en-1-ol;undec-2-en-1-ol (PubChem CID 173096541) has the molecular formula C24H46O2
and a molecular weight of 366.63 g/mol. Its IUPAC name is 2-ethyl-2-(3-methylbut-2-enyl)hex-3-en-1-ol;undec-2-en-1-ol.
Molecular Properties
| Compound Name | 2-ethyl-2-(3-methylbut-2-enyl)hex-3-en-1-ol;undec-2-en-1-ol |
| PubChem CID | 173096541 |
| Molecular Formula | C24H46O2 |
| Molecular Weight | 366.63 g/mol |
| Exact Mass | 366.35 |
| IUPAC Name | 2-ethyl-2-(3-methylbut-2-enyl)hex-3-en-1-ol;undec-2-en-1-ol |
| SMILES | CCC=CC(CC)(CO)CC=C(C)C.CCCCCCCCC=CCO |
| InChI | InChI=1S/C13H24O.C11H22O/c1-5-7-9-13(6-2,11-14)10-8-12(3)4;1-2-3-4-5-6-7-8-9-10-11-12/h7-9,14H,5-6,10-11H2,1-4H3;9-10,12H,2-8,11H2,1H3 |
| InChIKey | DLGMEZWLOUXPCH-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 366.63 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-2-(3-methylbut-2-enyl)hex-3-en-1-ol;undec-2-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-2-(3-methylbut-2-enyl)hex-3-en-1-ol;undec-2-en-1-ol?
The IUPAC name of 2-ethyl-2-(3-methylbut-2-enyl)hex-3-en-1-ol;undec-2-en-1-ol (CID 173096541) is 2-ethyl-2-(3-methylbut-2-enyl)hex-3-en-1-ol;undec-2-en-1-ol.
What is the SMILES notation for 2-ethyl-2-(3-methylbut-2-enyl)hex-3-en-1-ol;undec-2-en-1-ol?
The canonical SMILES for 2-ethyl-2-(3-methylbut-2-enyl)hex-3-en-1-ol;undec-2-en-1-ol is CCC=CC(CC)(CO)CC=C(C)C.CCCCCCCCC=CCO.
What is the InChIKey of 2-ethyl-2-(3-methylbut-2-enyl)hex-3-en-1-ol;undec-2-en-1-ol?
The InChIKey is DLGMEZWLOUXPCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24O.C11H22O/c1-5-7-9-13(6-2,11-14)10-8-12(3)4;1-2-3-4-5-6-7-8-9-10-11-12/h7-9,14H,5-6,10-11H2,1-4H3;9-10,12H,2-8,11H2,1H3.
What are the key properties of 2-ethyl-2-(3-methylbut-2-enyl)hex-3-en-1-ol;undec-2-en-1-ol?
2-ethyl-2-(3-methylbut-2-enyl)hex-3-en-1-ol;undec-2-en-1-ol has a molecular weight of 366.63 g/mol, XLogP of 6.98, 14 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-2-(3-methylbut-2-enyl)hex-3-en-1-ol;undec-2-en-1-ol is sourced from PubChem (CID 173096541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).