About 7-bromo-2,3-dimethylindazole-4-carboxamide
7-bromo-2,3-dimethylindazole-4-carboxamide (PubChem CID 173096594) has the molecular formula C10H10BrN3O
and a molecular weight of 268.11 g/mol. Its IUPAC name is 7-bromo-2,3-dimethylindazole-4-carboxamide.
Molecular Properties
| Compound Name | 7-bromo-2,3-dimethylindazole-4-carboxamide |
| PubChem CID | 173096594 |
| Molecular Formula | C10H10BrN3O |
| Molecular Weight | 268.11 g/mol |
| Exact Mass | 267.00 |
| IUPAC Name | 7-bromo-2,3-dimethylindazole-4-carboxamide |
| SMILES | Cc1c2c(C(N)=O)ccc(Br)c2nn1C |
| InChI | InChI=1S/C10H10BrN3O/c1-5-8-6(10(12)15)3-4-7(11)9(8)13-14(5)2/h3-4H,1-2H3,(H2,12,15) |
| InChIKey | JZJKURALHRDPNE-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.11 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-bromo-2,3-dimethylindazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-2,3-dimethylindazole-4-carboxamide?
The IUPAC name of 7-bromo-2,3-dimethylindazole-4-carboxamide (CID 173096594) is 7-bromo-2,3-dimethylindazole-4-carboxamide.
What is the SMILES notation for 7-bromo-2,3-dimethylindazole-4-carboxamide?
The canonical SMILES for 7-bromo-2,3-dimethylindazole-4-carboxamide is Cc1c2c(C(N)=O)ccc(Br)c2nn1C.
What is the InChIKey of 7-bromo-2,3-dimethylindazole-4-carboxamide?
The InChIKey is JZJKURALHRDPNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10BrN3O/c1-5-8-6(10(12)15)3-4-7(11)9(8)13-14(5)2/h3-4H,1-2H3,(H2,12,15).
What are the key properties of 7-bromo-2,3-dimethylindazole-4-carboxamide?
7-bromo-2,3-dimethylindazole-4-carboxamide has a molecular weight of 268.11 g/mol, XLogP of 1.74, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-2,3-dimethylindazole-4-carboxamide is sourced from PubChem (CID 173096594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).