C33H34N6O — CID 173096886
[(10R,25S)-8,14,21,27,35,36-hexazaoctacyclo[28.2.2.22,5.16,9.126,29.010,14.015,20.021,25]octatriaconta-1(32),2(38),3,5(37),6,8,26,28,30,33-decaen-16-ylidene]methanone (PubChem CID 173096886) has the molecular formula C33H34N6O and a molecular weight of 530.68 g/mol. Its IUPAC name is [(10R,25S)-8,14,21,27,35,36-hexazaoctacyclo[28.2.2.22,5.16,9.126,29.010,14.015,20.021,25]octatriaconta-1(32),2(38),3,5(37),6,8,26,28,30,33-decaen-16-ylidene]methanone.
| Compound Name | [(10R,25S)-8,14,21,27,35,36-hexazaoctacyclo[28.2.2.22,5.16,9.126,29.010,14.015,20.021,25]octatriaconta-1(32),2(38),3,5(37),6,8,26,28,30,33-decaen-16-ylidene]methanone |
|---|---|
| PubChem CID | 173096886 |
| Molecular Formula | C33H34N6O |
| Molecular Weight | 530.68 g/mol |
| Exact Mass | 530.28 |
| IUPAC Name | [(10R,25S)-8,14,21,27,35,36-hexazaoctacyclo[28.2.2.22,5.16,9.126,29.010,14.015,20.021,25]octatriaconta-1(32),2(38),3,5(37),6,8,26,28,30,33-decaen-16-ylidene]methanone |
| SMILES | O=C=C1CCCC2C1N1CCC[C@@H]1c1ncc([nH]1)-c1ccc(cc1)-c1ccc(cc1)-c1cnc([nH]1)[C@@H]1CCCN21 |
| InChI | InChI=1S/C33H34N6O/c40-20-25-4-1-5-28-31(25)39-17-3-7-30(39)33-35-19-27(37-33)24-14-10-22(11-15-24)21-8-12-23(13-9-21)26-18-34-32(36-26)29-6-2-16-38(28)29/h8-15,18-19,28-31H,1-7,16-17H2,(H,34,36)(H,35,37)/t28?,29-,30+,31?/m0/s1 |
| InChIKey | DMPDRTQEFGBHNE-VBSOKNSTSA-N |
| XLogP | 6.10 |
| TPSA | 80.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.68 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|