About 10-methyl-3,5-dithiatricyclo[5.2.1.02,6]dec-8-ene
10-methyl-3,5-dithiatricyclo[5.2.1.02,6]dec-8-ene (PubChem CID 173097168) has the molecular formula C9H12S2
and a molecular weight of 184.33 g/mol. Its IUPAC name is 10-methyl-3,5-dithiatricyclo[5.2.1.02,6]dec-8-ene.
Molecular Properties
| Compound Name | 10-methyl-3,5-dithiatricyclo[5.2.1.02,6]dec-8-ene |
| PubChem CID | 173097168 |
| Molecular Formula | C9H12S2 |
| Molecular Weight | 184.33 g/mol |
| Exact Mass | 184.04 |
| IUPAC Name | 10-methyl-3,5-dithiatricyclo[5.2.1.02,6]dec-8-ene |
| SMILES | CC1C2C=CC1C1SCSC21 |
| InChI | InChI=1S/C9H12S2/c1-5-6-2-3-7(5)9-8(6)10-4-11-9/h2-3,5-9H,4H2,1H3 |
| InChIKey | NVGWPNHRGXRUAJ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.33 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 10-methyl-3,5-dithiatricyclo[5.2.1.02,6]dec-8-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-methyl-3,5-dithiatricyclo[5.2.1.02,6]dec-8-ene?
The IUPAC name of 10-methyl-3,5-dithiatricyclo[5.2.1.02,6]dec-8-ene (CID 173097168) is 10-methyl-3,5-dithiatricyclo[5.2.1.02,6]dec-8-ene.
What is the SMILES notation for 10-methyl-3,5-dithiatricyclo[5.2.1.02,6]dec-8-ene?
The canonical SMILES for 10-methyl-3,5-dithiatricyclo[5.2.1.02,6]dec-8-ene is CC1C2C=CC1C1SCSC21.
What is the InChIKey of 10-methyl-3,5-dithiatricyclo[5.2.1.02,6]dec-8-ene?
The InChIKey is NVGWPNHRGXRUAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12S2/c1-5-6-2-3-7(5)9-8(6)10-4-11-9/h2-3,5-9H,4H2,1H3.
What are the key properties of 10-methyl-3,5-dithiatricyclo[5.2.1.02,6]dec-8-ene?
10-methyl-3,5-dithiatricyclo[5.2.1.02,6]dec-8-ene has a molecular weight of 184.33 g/mol, XLogP of 2.61, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 10-methyl-3,5-dithiatricyclo[5.2.1.02,6]dec-8-ene is sourced from PubChem (CID 173097168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).