C10H23NaO6S2 — CID 173097800
sodium;decane-1,10-disulfonic acid;hydride (PubChem CID 173097800) has the molecular formula C10H23NaO6S2 and a molecular weight of 326.41 g/mol. Its IUPAC name is sodium;decane-1,10-disulfonic acid;hydride.
| Compound Name | sodium;decane-1,10-disulfonic acid;hydride |
|---|---|
| PubChem CID | 173097800 |
| Molecular Formula | C10H23NaO6S2 |
| Molecular Weight | 326.41 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | sodium;decane-1,10-disulfonic acid;hydride |
| SMILES | O=S(=O)(O)CCCCCCCCCCS(=O)(=O)O.[H-].[Na+] |
| InChI | InChI=1S/C10H22O6S2.Na.H/c11-17(12,13)9-7-5-3-1-2-4-6-8-10-18(14,15)16;;/h1-10H2,(H,11,12,13)(H,14,15,16);;/q;+1;-1 |
| InChIKey | URRHLDJJJDCCSK-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.41 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|