C23H28N6O4 — CID 173098283
2-[4-[4-(4-amino-5-oxo-7,8-dihydropyrimido[5,4-f][1,4]oxazepin-6-yl)phenyl]cyclohexyl]-N-(N-hydroxy-C-methylcarbonimidoyl)acetamide (PubChem CID 173098283) has the molecular formula C23H28N6O4 and a molecular weight of 452.52 g/mol. Its IUPAC name is 2-[4-[4-(4-amino-5-oxo-7,8-dihydropyrimido[5,4-f][1,4]oxazepin-6-yl)phenyl]cyclohexyl]-N-(N-hydroxy-C-methylcarbonimidoyl)acetamide.
| Compound Name | 2-[4-[4-(4-amino-5-oxo-7,8-dihydropyrimido[5,4-f][1,4]oxazepin-6-yl)phenyl]cyclohexyl]-N-(N-hydroxy-C-methylcarbonimidoyl)acetamide |
|---|---|
| PubChem CID | 173098283 |
| Molecular Formula | C23H28N6O4 |
| Molecular Weight | 452.52 g/mol |
| Exact Mass | 452.22 |
| IUPAC Name | 2-[4-[4-(4-amino-5-oxo-7,8-dihydropyrimido[5,4-f][1,4]oxazepin-6-yl)phenyl]cyclohexyl]-N-(N-hydroxy-C-methylcarbonimidoyl)acetamide |
| SMILES | CC(=NO)NC(=O)CC1CCC(c2ccc(N3CCOc4ncnc(N)c4C3=O)cc2)CC1 |
| InChI | InChI=1S/C23H28N6O4/c1-14(28-32)27-19(30)12-15-2-4-16(5-3-15)17-6-8-18(9-7-17)29-10-11-33-22-20(23(29)31)21(24)25-13-26-22/h6-9,13,15-16,32H,2-5,10-12H2,1H3,(H2,24,25,26)(H,27,28,30) |
| InChIKey | FZHMVAJQTQZHGI-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 143.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.52 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|