About 2-cyclohexa-1,5-dien-1-ylethynyl(trimethyl)silane
2-cyclohexa-1,5-dien-1-ylethynyl(trimethyl)silane (PubChem CID 173098446) has the molecular formula C11H16Si
and a molecular weight of 176.34 g/mol. Its IUPAC name is 2-cyclohexa-1,5-dien-1-ylethynyl(trimethyl)silane.
Molecular Properties
| Compound Name | 2-cyclohexa-1,5-dien-1-ylethynyl(trimethyl)silane |
| PubChem CID | 173098446 |
| Molecular Formula | C11H16Si |
| Molecular Weight | 176.34 g/mol |
| Exact Mass | 176.10 |
| IUPAC Name | 2-cyclohexa-1,5-dien-1-ylethynyl(trimethyl)silane |
| SMILES | C[Si](C)(C)C#CC1=CCCC=C1 |
| InChI | InChI=1S/C11H16Si/c1-12(2,3)10-9-11-7-5-4-6-8-11/h5,7-8H,4,6H2,1-3H3 |
| InChIKey | GLXFORHWTHHXLZ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.34 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclohexa-1,5-dien-1-ylethynyl(trimethyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexa-1,5-dien-1-ylethynyl(trimethyl)silane?
The IUPAC name of 2-cyclohexa-1,5-dien-1-ylethynyl(trimethyl)silane (CID 173098446) is 2-cyclohexa-1,5-dien-1-ylethynyl(trimethyl)silane.
What is the SMILES notation for 2-cyclohexa-1,5-dien-1-ylethynyl(trimethyl)silane?
The canonical SMILES for 2-cyclohexa-1,5-dien-1-ylethynyl(trimethyl)silane is C[Si](C)(C)C#CC1=CCCC=C1.
What is the InChIKey of 2-cyclohexa-1,5-dien-1-ylethynyl(trimethyl)silane?
The InChIKey is GLXFORHWTHHXLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16Si/c1-12(2,3)10-9-11-7-5-4-6-8-11/h5,7-8H,4,6H2,1-3H3.
What are the key properties of 2-cyclohexa-1,5-dien-1-ylethynyl(trimethyl)silane?
2-cyclohexa-1,5-dien-1-ylethynyl(trimethyl)silane has a molecular weight of 176.34 g/mol, XLogP of 3.14, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexa-1,5-dien-1-ylethynyl(trimethyl)silane is sourced from PubChem (CID 173098446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).