C17H16Cl2N2O2S — CID 17309885
N-(3-acetamidophenyl)-2-[(3,4-dichlorophenyl)methylsulfanyl]acetamide (PubChem CID 17309885) has the molecular formula C17H16Cl2N2O2S and a molecular weight of 383.30 g/mol. Its IUPAC name is N-(3-acetamidophenyl)-2-[(3,4-dichlorophenyl)methylsulfanyl]acetamide.
| Compound Name | N-(3-acetamidophenyl)-2-[(3,4-dichlorophenyl)methylsulfanyl]acetamide |
|---|---|
| PubChem CID | 17309885 |
| Molecular Formula | C17H16Cl2N2O2S |
| Molecular Weight | 383.30 g/mol |
| Exact Mass | 382.03 |
| IUPAC Name | N-(3-acetamidophenyl)-2-[(3,4-dichlorophenyl)methylsulfanyl]acetamide |
| SMILES | CC(=O)Nc1cccc(NC(=O)CSCc2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C17H16Cl2N2O2S/c1-11(22)20-13-3-2-4-14(8-13)21-17(23)10-24-9-12-5-6-15(18)16(19)7-12/h2-8H,9-10H2,1H3,(H,20,22)(H,21,23) |
| InChIKey | NUZAWIHYVVAOSR-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.30 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |